CAS 55115-84-9

4-hydrazinopyrido[3',2':4,5]thieno[3,2-d]pyrimidine

Description:

4-Hydrazinopyrido[3',2':4,5]thieno[3,2-d]pyrimidine is a heterocyclic compound characterized by its complex fused ring structure, which incorporates both pyridine and thieno-pyrimidine moieties. This compound features a hydrazine functional group, which contributes to its reactivity and potential biological activity. It is typically a crystalline solid, exhibiting properties such as solubility in polar solvents, which may vary based on the specific conditions. The presence of nitrogen atoms in its structure suggests potential for hydrogen bonding and interactions with biological targets, making it of interest in medicinal chemistry. Its unique arrangement of heteroatoms can influence its electronic properties, potentially leading to interesting photophysical behavior. Additionally, compounds of this type may exhibit antimicrobial or anticancer activities, although specific biological data would depend on empirical studies. Overall, 4-hydrazinopyrido[3',2':4,5]thieno[3,2-d]pyrimidine represents a class of compounds that could be valuable in drug discovery and development.

Formula: C₉H₇N₅S

InChI: InChI=1/C9H7N5S/c10-14-8-7-6(12-4-13-8)5-2-1-3-11-9(5)15-7/h1-4H,10H2,(H,12,13,14)

SMILES: c1cc2c3c(c(=NN)[nH]cn3)sc2nc1

Synonyms:

• Pyrido[3',2':4,5]Thieno[3,2-D]Pyrimidine, 4-Hydrazinyl-
• 4-HYDRAZINOPYRIDO[3',2':4,5]THIENO[3,2-D]PYRIMIDINE

4-hydrazinopyrido[3',2':4,5]thieno[3,2-d]pyrimidine

CAS: 55115-84-9

4-hydrazinopyrido[3',2':4,5]thieno[3,2-d]pyrimidine

Purity: ≥95%

Molecular weight: 217.25g/mol

Ref: 54-OR25879