CymitQuimica logo

CAS 55115-99-6

:

(3S,5R)-1-benzyl-3,5-dimethyl-piperazine

Description:
(3S,5R)-1-benzyl-3,5-dimethyl-piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The specific stereochemistry indicated by the (3S,5R) notation refers to the spatial arrangement of substituents around the piperazine ring, which can significantly influence the compound's biological activity and interactions. The presence of a benzyl group at the nitrogen atom and two methyl groups at the 3 and 5 positions contributes to its lipophilicity, potentially enhancing its ability to cross biological membranes. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the development of therapeutic agents, particularly in areas related to the central nervous system. As with many piperazine derivatives, it may also interact with neurotransmitter receptors, which could be relevant for its biological effects. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C13H20N2
InChI:InChI=1/C13H20N2/c1-11-8-15(9-12(2)14-11)10-13-6-4-3-5-7-13/h3-7,11-12,14H,8-10H2,1-2H3/t11-,12+
Synonyms:
  • (3R,5S)-1-Benzyl-3,5-dimethylpiperazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • (3R,5S)-1-Benzyl-3,5-dimethylpiperazine

    Controlled Product
    CAS:
    Formula:C13H20N2
    Color and Shape:Neat
    Molecular weight:204.31

    Ref: TR-B276210

    1g
    496.00€