CymitQuimica logo

CAS 55121-99-8

:

(4-aminophenyl)(4-methylpiperazin-1-yl)methanone

Description:
(4-aminophenyl)(4-methylpiperazin-1-yl)methanone, with the CAS number 55121-99-8, is a chemical compound characterized by its unique structure that includes an aminophenyl group and a piperazine moiety. This compound typically exhibits properties associated with both aromatic amines and piperazine derivatives, which may influence its solubility, reactivity, and biological activity. It is likely to be a solid at room temperature, with potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The presence of the amino group suggests potential for hydrogen bonding, which can enhance solubility in polar solvents. Additionally, the piperazine ring may contribute to its pharmacological properties, as piperazine derivatives are often found in various therapeutic agents. Overall, this compound's characteristics make it a subject of interest in research related to drug design and development.
Formula:C12H17N3O
InChI:InChI=1/C12H17N3O/c1-14-6-8-15(9-7-14)12(16)10-2-4-11(13)5-3-10/h2-5H,6-9,13H2,1H3
InChI key:WTBSUAXLZLAHPE-UHFFFAOYSA-N
SMILES:CN1CCN(CC1)C(=O)c1ccc(cc1)N
Synonyms:
  • Methanone, (4-Aminophenyl)(4-Methyl-1-Piperazinyl)-
Found 3 products.