CAS 55129-21-0

2-[5-methyl-2-(propan-2-yl)phenoxy]ethanol

Description:

2-[5-Methyl-2-(propan-2-yl)phenoxy]ethanol, with the CAS number 55129-21-0, is an organic compound characterized by its ether and alcohol functional groups. This substance features a phenolic structure, where a phenyl ring is substituted with a methyl group and an isopropyl group, contributing to its hydrophobic characteristics. The presence of the hydroxyl (-OH) group in the ethanol moiety imparts polar characteristics, allowing for potential solubility in polar solvents. This compound is typically used in various applications, including as a surfactant or emulsifier in formulations due to its ability to reduce surface tension. Its molecular structure suggests it may exhibit moderate to low volatility and a relatively high boiling point compared to simpler alcohols. Additionally, the branched alkyl groups can enhance its stability and reduce reactivity compared to linear counterparts. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, its unique structure allows for diverse applications in industrial and consumer products.

Formula: C₁₂H₁₈O₂

InChI: InChI=1/C12H18O2/c1-9(2)11-5-4-10(3)8-12(11)14-7-6-13/h4-5,8-9,13H,6-7H2,1-3H3

SMILES: CC(C)c1ccc(C)cc1OCCO

2-Thymyloxyethanol

Controlled Product

CAS: 55129-21-0

Applications 2-Thymyloxyethanol is an intermediate in the synthesis of monoterpene compound that has a fresh minty camphor-like odour, and naturally occurs in extracts of commercial oil of peppermint.
References Birch, A. J., et al.: J. Chem. Soc., 2531 (1949);

Formula: C₁₂H₁₈O₂

Color and Shape: Neat

Molecular weight: 194.27

Ref: TR-T350360