CAS 5513-69-9
:N-cbz-gly-phe amide
Description:
N-Cbz-gly-phe amide, also known as N-carbobenzyloxy-glycine-phenylalanine amide, is a synthetic compound commonly used in peptide chemistry and drug development. It features a carbobenzyloxy (Cbz) protecting group on the glycine residue, which enhances its stability and solubility. The structure includes a glycine (Gly) and phenylalanine (Phe) amino acid sequence, making it a dipeptide derivative. This compound is typically characterized by its white to off-white crystalline appearance and is soluble in organic solvents like methanol and dimethyl sulfoxide (DMSO), but less soluble in water. N-Cbz-gly-phe amide is often utilized in the synthesis of more complex peptides and can serve as an intermediate in the preparation of biologically active compounds. Its amide functionality contributes to its stability and reactivity, making it a valuable building block in medicinal chemistry. As with many peptide derivatives, it is important to handle this compound with care, following appropriate safety protocols due to potential biological activity.
Formula:C19H21N3O4
InChI:InChI=1/C19H21N3O4/c20-18(24)16(11-14-7-3-1-4-8-14)22-17(23)12-21-19(25)26-13-15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H2,20,24)(H,21,25)(H,22,23)
SMILES:c1ccc(cc1)CC(C(=N)O)N=C(CN=C(O)OCc1ccccc1)O
Synonyms:- Z-Gly-Phe-NH2
- N-[(benzyloxy)carbonyl]glycyl-L-phenylalaninamide
- N-[(benzyloxy)carbonyl]glycylphenylalaninamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Z-Gly-Phe-NH2
CAS:<p>Z-Gly-Phe-NH2 is a peptide that inhibits protein synthesis by binding to the ribosome. It has been shown to inhibit enzyme preparations containing peptides and proteins, such as hydrogen bond formation, phase transition temperature, uptake, and inhibitory effect. This molecule may be used in biochemical or molecular studies of protein synthesis. The uptake of Z-Gly-Phe-NH2 can be inhibited by ouabain binding. Z-Gly-Phe-NH2 also has a ca2+ response when calcium ionophores are applied to Xenopus oocytes.</p>Formula:C19H20N2O5Purity:Min. 95%Molecular weight:355.39 g/mol
