
CAS 55138-63-1
:2-Methyl-5-(2-propen-1-yl)pyrazine
Description:
2-Methyl-5-(2-propen-1-yl)pyrazine is an organic compound characterized by its pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a methyl group and a propenyl group attached to the pyrazine ring, contributing to its unique chemical properties and reactivity. It is typically a colorless to pale yellow liquid with a distinctive odor, often described as nutty or roasted, making it of interest in flavor and fragrance applications. The presence of the double bond in the propenyl group can make it reactive, particularly in polymerization and addition reactions. Additionally, 2-Methyl-5-(2-propen-1-yl)pyrazine may exhibit biological activity, which could be relevant in various fields, including food science and pharmaceuticals. Its solubility characteristics generally indicate that it is more soluble in organic solvents than in water. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C8H10N2
InChI:InChI=1S/C8H10N2/c1-3-4-8-6-9-7(2)5-10-8/h3,5-6H,1,4H2,2H3
InChI key:InChIKey=JCZDTOUEQCNMKI-UHFFFAOYSA-N
SMILES:C(C=C)C=1C=NC(C)=CN1
Synonyms:- Pyrazine, 2-methyl-5-(2-propen-1-yl)-
- 2-Allyl-5-methylpyrazine
- 2-Methyl-5-(2-propen-1-yl)pyrazine
- Pyrazine, 2-methyl-5-(2-propenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
