CAS 55144-92-8

3-(2,4-dichlorophenyl)propanoic acid

Description:

3-(2,4-Dichlorophenyl)propanoic acid, with the CAS number 55144-92-8, is an organic compound characterized by its propanoic acid backbone substituted with a 2,4-dichlorophenyl group. This compound typically appears as a white to off-white solid and is known for its moderate solubility in organic solvents, while being less soluble in water. The presence of the dichlorophenyl moiety contributes to its potential biological activity, making it of interest in pharmaceutical and agrochemical research. The compound may exhibit various functional properties, including potential herbicidal or anti-inflammatory effects, depending on its specific application. Its molecular structure includes a carboxylic acid functional group, which imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification or amidation. Safety and handling precautions are essential, as with many chlorinated compounds, due to potential toxicity and environmental concerns. Overall, 3-(2,4-dichlorophenyl)propanoic acid is a compound of interest in both synthetic chemistry and applied sciences.

Formula: C₉H₈Cl₂O₂

InChI: InChI=1/C9H8Cl2O2/c10-7-3-1-6(8(11)5-7)2-4-9(12)13/h1,3,5H,2,4H2,(H,12,13)

SMILES: c1cc(cc(c1CCC(=O)O)Cl)Cl

Synonyms:

• 3-(2,4-Dichlorophenyl)propionic acid

3-(2,4-DICHLOROPHENYL)PROPANOIC ACID

CAS: 55144-92-8

Formula: C₉H₈Cl₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 219.0646

Ref: IN-DA003B9Y

3-(2,4-Dichlorophenyl)propanoic acid

CAS: 55144-92-8

3-(2,4-Dichlorophenyl)propanoic acid

Formula: C₉H₈Cl₂O₂

Purity: 98%

Color and Shape: cream solid

Molecular weight: 219.06g/mol

Ref: 54-OR29293

3-(2,4-Dichlorophenyl)propionic acid

CAS: 55144-92-8

Formula: C₉H₈Cl₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 219.06

Ref: 10-F018534