CAS 55145-45-4

4-{[tert-butyl(dimethyl)silyl]oxy}cyclohexanone

Description:

4-{[tert-butyl(dimethyl)silyl]oxy}cyclohexanone, with the CAS number 55145-45-4, is an organic compound characterized by its cyclohexanone core, which is a six-membered cyclic ketone. The presence of a tert-butyl(dimethyl)silyl group introduces significant steric bulk and hydrophobic characteristics, enhancing the compound's stability and solubility in non-polar solvents. This silyl ether functionality can also serve as a protective group in synthetic chemistry, allowing for selective reactions. The compound typically exhibits a colorless to pale yellow appearance and may have a characteristic odor associated with ketones. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or as an intermediate in various chemical reactions. Additionally, the presence of the silyl group may influence the compound's reactivity, making it useful in specific catalytic processes or as a reagent in organic transformations. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₂H₂₄O₂Si

InChI: InChI=1/C12H24O2Si/c1-12(2,3)15(4,5)14-11-8-6-10(13)7-9-11/h11H,6-9H2,1-5H3

SMILES: CC(C)(C)[Si](C)(C)OC1CCC(=O)CC1

4-(t-Butyldimethylsilyloxy)cyclohexan-1-one

CAS: 55145-45-4

Formula: C₁₂H₂₄O₂Si

Purity: 95%

Color and Shape: Solid

Molecular weight: 228.4033

Ref: IN-DA0038NY

4-((tert-Butyldimethylsilyl)oxy)cyclohexan-1-one

CAS: 55145-45-4

4-((tert-Butyldimethylsilyl)oxy)cyclohexan-1-one

Purity: 98%

Molecular weight: 228.41g/mol

Ref: 54-OR74318

4-((tert-Butyldimethylsilyl)oxy)cyclohexanone

CAS: 55145-45-4

Formula: C₁₂H₂₄O₂Si

Purity: 95%

Color and Shape: Liquid

Molecular weight: 228.407

Ref: 10-F324489