CAS 551925-55-4

1-[(5-bromofuran-2-yl)carbonyl]-1H-pyrazole

Description:

1-[(5-bromofuran-2-yl)carbonyl]-1H-pyrazole is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a furan moiety substituted with a bromine atom. The presence of the carbonyl group linked to the furan enhances its reactivity and potential applications in organic synthesis. This compound typically exhibits properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The bromine substituent may influence its electronic properties and reactivity, allowing for further functionalization. Additionally, the compound's specific interactions with biological targets can be explored for therapeutic applications. Overall, 1-[(5-bromofuran-2-yl)carbonyl]-1H-pyrazole represents a versatile scaffold for further chemical modifications and investigations in various fields, including pharmaceuticals and agrochemicals.

Formula: C₈H₅BrN₂O₂

InChI: InChI=1/C8H5BrN2O2/c9-7-3-2-6(13-7)8(12)11-5-1-4-10-11/h1-5H

SMILES: c1cnn(c1)C(=O)c1ccc(Br)o1

Synonyms:

• (5-Bromo-2-furyl)(1H-pyrazol-1-yl)methanone
• methanone, (5-bromo-2-furanyl)-1H-pyrazol-1-yl-

1-(5-bromo-2-furoyl)-1H-pyrazole

CAS: 551925-55-4

Formula: C₈H₅BrN₂O₂

Purity: 95.0%

Molecular weight: 241.044

Ref: 10-F314808