CAS 55196-48-0
:Isoorientin 2′′-O-glucoside
Description:
Isoorientin 2′′-O-glucoside, with the CAS number 55196-48-0, is a flavonoid glycoside that is derived from the flavonoid isoorientin. This compound is characterized by its structure, which includes a flavone backbone with a glucose moiety attached at the 2′′ position. Isoorientin 2′′-O-glucoside is known for its potential antioxidant properties, which may contribute to various health benefits, including anti-inflammatory and cardioprotective effects. It is commonly found in various plant sources, particularly in certain herbs and vegetables, and is often studied for its role in traditional medicine. The compound is soluble in polar solvents, which facilitates its extraction from plant materials. Additionally, it may exhibit bioactivity that can influence metabolic processes, making it of interest in nutritional and pharmaceutical research. Overall, Isoorientin 2′′-O-glucoside represents a significant area of study within the field of natural products and phytochemistry due to its potential health-promoting properties.
Formula:C27H30O16
InChI:InChI=1S/C27H30O16/c28-6-15-20(35)23(38)26(43-27-24(39)22(37)19(34)16(7-29)42-27)25(41-15)18-12(33)5-14-17(21(18)36)11(32)4-13(40-14)8-1-2-9(30)10(31)3-8/h1-5,15-16,19-20,22-31,33-39H,6-7H2/t15-,16-,19-,20-,22+,23+,24-,25+,26-,27+/m1/s1
InChI key:InChIKey=QWAZWXOCSOFIPS-FASGCTRLSA-N
SMILES:OC=1C(=C(O)C=C2C1C(=O)C=C(O2)C3=CC(O)=C(O)C=C3)[C@H]4[C@H](O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@@H](CO)O4
Synonyms:- Isoorientin 2′′-O-glucoside
- Meloside L
- 2-(3,4-Dihydroxyphenyl)-6-(2-O-β-D-glucopyranosyl-β-D-glucopyranosyl)-5,7-dihydroxy-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-6-(2-O-β-D-glucopyranosyl-β-D-glucopyranosyl)-5,7-dihydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
