CAS 552-59-0
:5-hydroxy-3-(4-hydroxyphenyl)-7-methoxy-4-benzopyrone
Description:
5-Hydroxy-3-(4-hydroxyphenyl)-7-methoxy-4-benzopyrone, also known as umbelliferone or by its CAS number 552-59-0, is a naturally occurring coumarin derivative. This compound is characterized by its benzopyrone structure, which consists of a fused benzene and pyrone ring. It exhibits a range of biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties, making it of interest in pharmacological research. The presence of hydroxyl groups enhances its reactivity and solubility in polar solvents, while the methoxy group contributes to its stability and lipophilicity. Umbelliferone is often studied for its potential therapeutic applications, particularly in the fields of cancer research and skin protection due to its ability to absorb ultraviolet light. Additionally, it is found in various plants, contributing to their medicinal properties. Its chemical behavior can be influenced by environmental factors, and it is often used as a fluorescent probe in biochemical assays. Overall, this compound represents a significant area of interest in both natural product chemistry and medicinal chemistry.
Formula:C16H12O5
InChI:InChI=1/C16H12O5/c1-20-11-6-13(18)15-14(7-11)21-8-12(16(15)19)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3
InChI key:InChIKey=KQMVAGISDHMXJJ-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(OC)=CC2O)OC=C1C3=CC=C(O)C=C3
Synonyms:- 4H-1-benzopyran-4-one, 5-hydroxy-3-(4-hydroxyphenyl)-7-methoxy-
- 5,4′-Dihydroxy-7-methoxyisoflavone
- 5-Hydroxy-3-(4-hydroxyphenyl)-7-methoxy-4H-1-benzopyran-4-one
- 5-Hydroxy-3-(4-hydroxyphenyl)-7-methoxy-4H-chromen-4-on
- 5-Hydroxy-3-(4-hydroxyphenyl)-7-methoxy-4H-chromen-4-one
- 7-O-Methylgenistein
- Isoflavone, 4′,5-dihydroxy-7-methoxy-
- Prunetin
- Prunusetin
- 5-Hydroxy-3-(4-hydroxyphenyl)-7-methoxychromen-4-one
- 4',5-DIHYDROXY-7-METHOXYISOFLAVONE
- 4’,5-dihydroxy-7-methoxy-isoflavon
- 5-hydroxy-3-(4-hydroxyphenyl)-7-methoxy-4-benzopyrone
- 3-(p-Hydroxyphenyl)-5-hydroxy-7-methoxychromone
- PRUNETIN(RG)
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 14 products.
5-Hydroxy-3-(4-hydroxyphenyl)-7-methoxy-4H-chromen-4-one
CAS:Purity:95.0%Molecular weight:284.2669982910156Prunetin
CAS:Prunetin analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C16H12O5Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:284.27Prunetin; 7-O-Methylgenistein
CAS:Formula:C16H12O5Purity:88.62%Color and Shape:Brownish. SolidMolecular weight:284.04H-1-Benzopyran-4-one, 5-hydroxy-3-(4-hydroxyphenyl)-7-methoxy-
CAS:Formula:C16H12O5Purity:95%Color and Shape:SolidMolecular weight:284.2635Prunetin
CAS:Formula:C16H12O5Purity:>90.0%(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:284.27Prunetin
CAS:Prunetin reduces inflammation, mortality, obesity markers, and mucin secretion, while blocking NF-κB, ERK activation, and improving cellular barriers.Formula:C16H12O5Purity:98.43% - ≥95%Color and Shape:Creamy White Crystalline PowderMolecular weight:284.26Prunetin
CAS:Prunetin analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.
Formula:C16H12O5Purity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:284.28Prunetin
CAS:Prunetin is a naturally occurring isoflavone, which is an organic compound derived from plant sources. It is primarily found in legumes and other plant materials where it naturally occurs as part of the plant's phytochemical arsenal. The mode of action of prunetin involves modulating various biochemical pathways, including acting as an antioxidant, influencing estrogenic activity, and affecting cellular signaling pathways. Its biochemical properties allow it to interact with multiple cellular targets, leading to its diverse biological activities.
Formula:C16H12O5Purity:Min. 95%Color and Shape:Slightly Brown PowderMolecular weight:284.26 g/mol










