CAS 55206-11-6
:3-(2-aminoethyl)-1H-indol-4-ol; 2-amino-3-methyl-4H-imidazol-5-one; sulfuric acid
Description:
The chemical substance with the name "3-(2-aminoethyl)-1H-indol-4-ol; 2-amino-3-methyl-4H-imidazol-5-one; sulfuric acid" and CAS number 55206-11-6 is a complex compound that features multiple functional groups, including an indole derivative and an imidazole derivative, along with sulfuric acid. The presence of the indole structure suggests potential biological activity, as indoles are known for their roles in various biochemical processes and as precursors to many natural products. The imidazole moiety contributes to the compound's potential as a ligand in coordination chemistry and its involvement in enzymatic reactions. Sulfuric acid, a strong acid, indicates that the compound may exhibit acidic properties, influencing its solubility and reactivity in various environments. Overall, this compound may have applications in pharmaceuticals, biochemistry, and materials science, although specific characteristics such as solubility, stability, and reactivity would depend on the conditions under which it is studied.
Formula:C14H21N5O6S
InChI:InChI=1/C10H12N2O.C4H7N3O.H2O4S/c11-5-4-7-6-12-8-2-1-3-9(13)10(7)8;1-7-2-3(8)6-4(7)5;1-5(2,3)4/h1-3,6,12-13H,4-5,11H2;2H2,1H3,(H2,5,6,8);(H2,1,2,3,4)
SMILES:c1cc2c(c(CCN)c[nH]2)c(c1)O.CN1CC(=NC1=N)O.OS(=O)(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Hydroxytryptamine creatinine sulfate
CAS:4-Hydroxytryptamine creatinine sulfate, a derivative of tryptamine, acts as an agonist for neurotransmitters.Formula:C14H21N5O6SColor and Shape:SolidMolecular weight:387.414-Hydroxytryptamine Creatinine Sulfate
CAS:Controlled Product<p>Stability Hygroscopic<br>Applications A tryptamine derivative, a neurotransmitter agonist.<br>References Creveling, C. R., et al.: Mol. Pharmacol., 11, 211 (1975),<br></p>Formula:C10H12N2O·C4H10N4O·H2O4SColor and Shape:NeatMolecular weight:404.444-Hydroxytryptamine creatinine sulfate
CAS:<p>Please enquire for more information about 4-Hydroxytryptamine creatinine sulfate including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C10H12N2O•C4H7N3O•H2O4SPurity:Min. 95%Molecular weight:387.41 g/mol


