CAS 55206-24-1
:6-Fluorotryptamine hydrochloride
Description:
6-Fluorotryptamine hydrochloride is a chemical compound derived from tryptamine, characterized by the presence of a fluorine atom at the 6-position of the indole ring. This modification can influence its biological activity and receptor interactions. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various biochemical applications. The compound is often studied for its potential effects on serotonin receptors, making it of interest in neuropharmacology and medicinal chemistry. Its structural similarity to serotonin suggests that it may exhibit psychoactive properties, although specific effects can vary based on dosage and context. In laboratory settings, 6-Fluorotryptamine hydrochloride is utilized in research related to neurotransmitter systems and may serve as a precursor in the synthesis of other bioactive compounds. Safety and handling precautions are essential, as with any chemical substance, due to potential toxicity and the need for proper storage conditions to maintain stability.
Formula:C10H11FN2·ClH
InChI:InChI=1S/C10H11FN2.ClH/c11-8-1-2-9-7(3-4-12)6-13-10(9)5-8;/h1-2,5-6,13H,3-4,12H2;1H
InChI key:InChIKey=ODVDIBHWTMTHOS-UHFFFAOYSA-N
SMILES:C(CN)C=1C=2C(=CC(F)=CC2)NC1.Cl
Synonyms:- 1H-Indole-3-ethanamine, 6-fluoro-, hydrochloride (1:1)
- 1H-Indole-3-ethanamine, 6-fluoro-, monohydrochloride
- 2-(6-Fluoro-1H-indol-3-yl)ethan-1-amine hydrochloride
- 2-(6-Fluoro-1H-indol-3-yl)ethanamine hydrochloride (1:1)
- 2-(6-fluoro-1H-indol-3-yl)ethanamine hydrochloride
- 2-(6-fluoro-1H-indol-3-yl)ethanaminium
- 3-(2-Aminoethyl)-6-fluoroindole hydrochloride
- 6-Fluorotryptamine hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
6-Fluorotryptamine, HCl
CAS:Formula:C10H12ClFN2Purity:98%Color and Shape:SolidMolecular weight:214.66716-Fluorotryptamine hydrochloride
CAS:6-Fluorotryptamine HCl is a serotonin derivative, agonist at 5-HT2A/C receptors, with potential for psychiatric and neurological drug development.Formula:C10H12ClFN2Purity:97.12%Color and Shape:White To Off-White Powder Crystals Crystalline Powder And/Or ChunksMolecular weight:214.676-Fluorotryptamine hydrochloride
CAS:Controlled Product6-Fluorotryptamine hydrochloride is a fine chemical that is a versatile building block with many applications in the research and development of pharmaceuticals, especially as a reagent for the synthesis of complex compounds.Formula:C10H12ClFN2Purity:Min. 99 Area-%Molecular weight:214.67 g/mol


