CAS 5521-39-1

2-[4-(4-aminophenyl)piperazin-1-yl]ethanol

Description:

2-[4-(4-aminophenyl)piperazin-1-yl]ethanol, with the CAS number 5521-39-1, is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features an ethanol moiety, contributing to its solubility in polar solvents. The presence of the 4-aminophenyl group enhances its potential for biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting the central nervous system. The compound is typically a white to off-white solid and may exhibit basic properties due to the amine groups. Its structure allows for various interactions with biological targets, which can influence its pharmacokinetic and pharmacodynamic profiles. Additionally, it may undergo various chemical reactions, including alkylation and acylation, which can be utilized in synthetic applications. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₂H₁₉N₃O

InChI: InChI=1/C12H19N3O/c13-11-1-3-12(4-2-11)15-7-5-14(6-8-15)9-10-16/h1-4,16H,5-10,13H2

SMILES: c1cc(ccc1N)N1CCN(CC1)CCO

Synonyms:

• 1-Piperazineethanol, 4-(4-aminophenyl)-
• 2-[4-(4-Aminophenyl)-1-Piperazinyl]Ethanol
• 2-[4-(4-Amino-phenyl)-piperazin-1-yl]-ethanol
• 2-[4-(4-Aminophenyl)piperazin-1-yl]ethanol

2-[4-(4-Amino-phenyl)-piperazin-1-yl]ethanol

CAS: 5521-39-1

Formula: C₁₂H₁₉N₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 221.2988

Ref: IN-DA00DCX8

4-[4-(2-Hydroxyethyl)piperazin-1-yl]aniline

CAS: 5521-39-1

4-[4-(2-Hydroxyethyl)piperazin-1-yl]aniline

Purity: 97%

Molecular weight: 221.30g/mol

Ref: 54-OR13814