CAS 55211-75-1

2,3-Dihydro-6-methyl-1H-imidazo[1,2-b]pyrazole

Description:

2,3-Dihydro-6-methyl-1H-imidazo[1,2-b]pyrazole is a heterocyclic organic compound characterized by its bicyclic structure, which includes both imidazole and pyrazole rings. This compound typically exhibits a molecular formula that reflects its composition of carbon, hydrogen, and nitrogen atoms. It is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the methyl group at the 6-position of the imidazo ring can influence its reactivity and interaction with biological targets. Additionally, the dihydro form indicates that the compound has two hydrogen atoms added to the ring structure, which can affect its stability and solubility. The compound may also exhibit various physical properties such as melting point, boiling point, and solubility in different solvents, which are essential for understanding its behavior in chemical reactions and applications. Overall, 2,3-Dihydro-6-methyl-1H-imidazo[1,2-b]pyrazole represents a significant class of compounds with diverse applications in pharmaceuticals and agrochemicals.

Formula: C₆H₉N₃

InChI: InChI=1S/C6H9N3/c1-5-4-6-7-2-3-9(6)8-5/h4,7H,2-3H2,1H3

InChI key: InChIKey=ZPBDVKXZYOMZLC-UHFFFAOYSA-N

SMILES: CC=1C=C2N(N1)CCN2

Synonyms:

• 1H-Imidazo[1,2-b]pyrazole, 2,3-dihydro-6-methyl-
• 2,3-Dihydro-6-methyl-1H-imidazo[1,2-b]pyrazole

6-Methyl-1H,2H,3H-pyrazolo[1,5-a]imidazole

CAS: 55211-75-1

Versatile small molecule scaffold

Formula: C₆H₉N₃

Purity: Min. 95%

Molecular weight: 123.16 g/mol

Ref: 3D-FCA21175