CAS 55212-35-6

1-[4-(methylsulfanyl)benzyl]piperazine

Description:

1-[4-(Methylsulfanyl)benzyl]piperazine, identified by its CAS number 55212-35-6, is an organic compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a benzyl group substituted with a methylsulfanyl group at the para position, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in organic solvents, reflecting its moderate polarity. The presence of the methylsulfanyl group can influence its biological activity, potentially affecting interactions with various biological targets. This compound may be of interest in medicinal chemistry and pharmacology due to its structural features, which can be associated with various pharmacological effects. Its synthesis and characterization involve standard organic chemistry techniques, and it may be used in research related to neuropharmacology or as a building block in the development of more complex molecules. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₂H₁₈N₂S

InChI: InChI=1/C12H18N2S/c1-15-12-4-2-11(3-5-12)10-14-8-6-13-7-9-14/h2-5,13H,6-10H2,1H3

SMILES: CSc1ccc(cc1)CN1CCNCC1

Synonyms:

• Piperazine, 1-[[4-(Methylthio)Phenyl]Methyl]-

1-[4-(Methylthio)benzyl]piperazine

Controlled Product

CAS: 55212-35-6

1-[4-(Methylthio)benzyl]piperazine is an organic compound that is used as a corrosion inhibitor in the treatment of industrial wastewater. The reaction solution is typically a mixture of copper chloride, ethylene diamine, and potassium dichromate. This compound is also known as a bound form of methylthiobenzoic acid. 1-[4-(Methylthio)benzyl]piperazine binds to copper ions, preventing the formation of copper oxide and hydroxide. It also reacts with chromium ions to form a soluble product that can be easily removed from the water by filtration or sedimentation. The profile for this compound shows that it has low energy and does not react with sodium hydroxide or hydrochloric acid.

Formula: C₁₂H₁₈N₂S

Purity: Min. 95%

Molecular weight: 222.35 g/mol

Ref: 3D-FM113848