CAS 55216-11-0
:heptakis(2,3,6-tri-O-methyl)-beta-cyclodextrin
Description:
Heptakis(2,3,6-tri-O-methyl)-beta-cyclodextrin is a modified form of beta-cyclodextrin, a cyclic oligosaccharide composed of seven glucose units. This compound features multiple methoxy groups, which enhance its solubility in organic solvents and improve its ability to form inclusion complexes with various guest molecules. The presence of these methyl groups alters the hydrophilicity and hydrophobicity of the cyclodextrin, making it particularly useful in pharmaceutical applications for drug delivery and stabilization. Its unique structure allows it to encapsulate a wide range of hydrophobic compounds, thereby enhancing their solubility and bioavailability. Additionally, this derivative exhibits low toxicity and good biocompatibility, making it suitable for various biomedical applications. The compound is typically characterized by techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. Overall, heptakis(2,3,6-tri-O-methyl)-beta-cyclodextrin is a versatile compound with significant potential in drug formulation and delivery systems.
Formula:C63H112O35
InChI:InChI=1/C63H112O35/c1-64-22-29-36-43(71-8)50(78-15)57(85-29)93-37-30(23-65-2)87-59(52(80-17)44(37)72-9)95-39-32(25-67-4)89-61(54(82-19)46(39)74-11)97-41-34(27-69-6)91-63(56(84-21)48(41)76-13)98-42-35(28-70-7)90-62(55(83-20)49(42)77-14)96-40-33(26-68-5)88-60(53(81-18)47(40)75-12)94-38-31(24-66-3)86-58(92-36)51(79-16)45(38)73-10/h29-63H,22-28H2,1-21H3/t29-,30-,31-,32-,33-,34-,35-,36-,37-,38-,39-,40-,41-,42-,43+,44+,45+,46+,47+,48+,49+,50-,51-,52-,53-,54-,55-,56-,57-,58-,59-,60-,61-,62-,63-/m1/s1
Synonyms:- heptakis(2,3,6-tri-O-methyl)-B-*cyclodextrin
- Trimethyl--cyclodextrin
- (1R,3R,5R,6R,8R,10R,11R,13R,15R,16R,18R,20R,21R,23R,25R,26R,28R,30R,31R,33R,35R,36S,37R,38S,39R,40S,41R,42S,43R,44S,45R,46S,47R,48S,49R)-36,37,38,39,40,41,42,43,44,45,46,47,48,49-tetradecamethoxy-5,10,15,20,25,30,35-heptakis(methoxymethyl)-2,4,7,9,12,14,17,19,22,24,27,29,32,34-tetradecaoxaoctacyclo[31.2.2.2~3,6~.2~8,11~.2~13,16~.2~18,21~.2~23,26~.2~28,31~]nonatetracontane (non-preferred name)
- Methyl-Beta-Cyclodextrin, 2,3,6-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Trimethyl-β-cyclodextrin
CAS:Formula:C63H112O35Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:1,429.55Trimethyl-β-cyclodextrin
CAS:Formula:C63H112O35Purity:97%Color and Shape:SolidMolecular weight:1429.5424Heptakis(2,3,6-tri-O-methyl)-β-cyclodextrin
CAS:Heptakis(2,3,6-tri-O-methyl)-β-cyclodextrinPurity:98%Heptakis(2,3,6-tri-O-methyl)-β-cyclodextrin
CAS:Formula:C63H112O35Purity:≥ 98.0%Color and Shape:White to off-white crystalline powderMolecular weight:1429.54Heptakis-(2,3,6-tri-O-methyl)-β-cyclodextrin
CAS:This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.Formula:C63H112O35Purity:Min. 95%Color and Shape:PowderMolecular weight:1,429.54 g/mol






