CAS 55217-15-7
:3-(4,5-diphenyl-1H-imidazol-2-yl)propanoic acid
Description:
3-(4,5-Diphenyl-1H-imidazol-2-yl)propanoic acid, with the CAS number 55217-15-7, is an organic compound characterized by its imidazole ring and propanoic acid functional group. This substance features a central propanoic acid moiety attached to a 4,5-diphenyl-substituted imidazole, which contributes to its unique chemical properties. The presence of the imidazole ring imparts potential biological activity, making it of interest in pharmaceutical research. The compound is likely to exhibit moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic phenyl groups. Its structure suggests potential for hydrogen bonding due to the carboxylic acid group, which can influence its reactivity and interactions with other molecules. Additionally, the compound may exhibit interesting optical properties due to the presence of multiple aromatic rings. Overall, 3-(4,5-diphenyl-1H-imidazol-2-yl)propanoic acid is a compound of interest in both synthetic chemistry and medicinal applications, warranting further investigation into its properties and potential uses.
Formula:C18H16N2O2
InChI:InChI=1/C18H16N2O2/c21-16(22)12-11-15-19-17(13-7-3-1-4-8-13)18(20-15)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,19,20)(H,21,22)
SMILES:c1ccc(cc1)c1c(c2ccccc2)[nH]c(CCC(=O)O)n1
Synonyms:- Oxaprozin Impurity 1
- 3-(4,5-diphenyl-1H-imidazol-2-yl)propanoic acid
- 1H-Imidazole-2-propanoic acid, 4,5-diphenyl-
- Oxaprozin Impurity 1 (4,5-Diphenylimidazole-2-propionic acid)
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Oxaprozin Impurity 1
CAS:Formula:C18H16N2O2Color and Shape:White To Off-White SolidMolecular weight:292.344,5-Diphenyl-1H-imidazole-2-propanoic Acid
CAS:Controlled ProductApplications 4,5-Diphenyl-1H-imidazole-2-propanoic Acid is an impurity of Oxaprozin (O845400), an anti-inflammatory drug. Oxaprozin was comparable to Aspirin (A687780).
References Whitehouse, M.W., et al.: Biochem. Pharmacol., 20, 2309 (1971); Janssen, F.W., et al.: Drug Metab. Dispos., 6, 465 (1978); Shriver, D.A., et al.: Toxicol. Appl. Pharmacol., 42, 75 (1977)Formula:C18H16N2O2Color and Shape:NeatMolecular weight:292.334,5-Diphenyl-1H-imidazole-2-propanoic acid
CAS:Please enquire for more information about 4,5-Diphenyl-1H-imidazole-2-propanoic acid including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C18H16N2O2Purity:Min. 95%Molecular weight:292.3 g/mol



