CAS 55219-11-9

Benzothiophene-2-carbonitrile

Description:

Benzothiophene-2-carbonitrile is an organic compound characterized by its unique structure, which combines a benzothiophene moiety with a cyano group. This compound features a fused ring system that includes a thiophene ring, contributing to its aromatic properties and potential reactivity. The presence of the cyano group (-C≡N) enhances its polarity and can influence its solubility in various solvents. Benzothiophene derivatives are often studied for their applications in organic electronics, pharmaceuticals, and as intermediates in synthetic chemistry due to their interesting electronic and optical properties. The compound may exhibit biological activity, making it of interest in medicinal chemistry. Its stability and reactivity can be influenced by the substituents on the benzothiophene ring, which can affect its interactions in chemical reactions. Overall, Benzothiophene-2-carbonitrile is a versatile compound with potential applications in various fields of chemistry and materials science.

Formula: C₉H₅NS

InChI: InChI=1/C9H5NS/c10-6-8-5-7-3-1-2-4-9(7)11-8/h1-5H

SMILES: c1ccc2c(c1)cc(C#N)s2

Synonyms:

• Benzo[B]Thiophene-2-Carbonitrile
• 1-Benzothiophene-2-Carbonitrile

Benzo[b]thiophene-2-carbonitrile

CAS: 55219-11-9

Formula: C₉H₅NS

Purity: 97%

Color and Shape: Solid

Molecular weight: 159.2077

Ref: IN-DA00I9UM

Benzothiophene-2-carbonitrile

CAS: 55219-11-9

Benzothiophene-2-carbonitrile

Purity: 99%

Molecular weight: 159.21g/mol

Ref: 54-OR905297

Benzo[b]thiophene-2-carbonitrile

CAS: 55219-11-9

Formula: C₉H₅NS

Purity: 97%

Color and Shape: Solid

Molecular weight: 159.21

Ref: 10-F077287

Benzo[b]thiophene-2-carbonitrile

CAS: 55219-11-9

Benzo[b]thiophene-2-carbonitrile is a naphthalene derivative with a catalytic backbones. It is a new synthetic method that provides the opportunity to access benzo[b]thiophene-2-carboxylic acid and 2,6-dibromo-benzo[b]thiophene in one step. This reaction has been found to be effective for the synthesis of various heterocycles, such as 3,4-dihydroquinoxaline, 2,6-dibromo-pyridine, and 6-(3'-chlorophenyl)-1H-[1']benzopyran. The optical properties of this compound have been investigated by UV/visible spectroscopy and shown to exhibit an intense blue color. Benzo[b]thiophene-2-carbonitrile can also act as an electron acceptor or donor in organic reactions with halogen substituents

Formula: C₉H₅NS

Purity: Min. 95%

Molecular weight: 159.21 g/mol

Ref: 3D-FB143739