CAS 5522-55-4
:Uracil-1,3-15N2,99 atom % 15N
Description:
Uracil-1,3-15N2,99 atom % 15N, with the CAS number 5522-55-4, is a nitrogen-labeled derivative of uracil, a pyrimidine nucleobase found in RNA. This compound features two nitrogen-15 isotopes (15N) incorporated at the 1 and 3 positions of the uracil structure, which is significant for various biochemical and analytical applications, particularly in studies involving nitrogen metabolism and nucleic acid research. The high isotopic enrichment (99 atom % 15N) allows for precise tracking and quantification in metabolic studies using techniques such as mass spectrometry or nuclear magnetic resonance (NMR) spectroscopy. Uracil itself is known for its role in RNA synthesis and function, pairing with adenine during transcription. The incorporation of stable isotopes like 15N can enhance the understanding of metabolic pathways and the behavior of nucleic acids in biological systems. As a chemical substance, it is typically handled under standard laboratory safety protocols, and its stability and reactivity are consistent with those of other nucleobases.
Formula:C4H415N2O2
InChI:InChI=1/C4H4N2O2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8)/i5+1,6+1
Synonyms:- Uracil-1,3-15N2
- 1H-pyrimidine-2,4-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Uracil-15N2
CAS:Controlled Product<p>Applications Uracil-15N2 can be used as a stable-isotopic standard to measure of post-replicative DNA metabolic and damage in brains of rodents. This compound can also be used for isotope tracing to determine the mechanism and stem-cell activity of 5-carboxycytosine decarboxylation.<br>References Patel, J.P., et.al., Chem. Res. Toxicol., 28, 2352-2363, (2015); Schiesser, S., et.al., Angew. Chem. Int. Ed., 51,6516-6520, (2012);<br></p>Formula:C4H415N2O2Color and Shape:NeatMolecular weight:114.07
