CAS 5522-63-4
:2,7,12,18-Tetramethyl 3,8,13,17-tetramethyl-21H,23H-porphine-2,7,12,18-tetrapropanoate
Description:
2,7,12,18-Tetramethyl 3,8,13,17-tetramethyl-21H,23H-porphine-2,7,12,18-tetrapropanoate, with CAS number 5522-63-4, is a synthetic porphyrin derivative characterized by its complex macrocyclic structure, which includes multiple methyl and propanoate substituents. Porphyrins are known for their ability to coordinate metal ions, making them significant in various biological and industrial processes, particularly in catalysis and as pigments. This specific compound features a highly substituted porphyrin core, which can influence its solubility, stability, and reactivity. The presence of multiple methyl groups enhances its lipophilicity, while the propanoate groups can provide sites for further chemical modification or interaction with biological systems. Such porphyrin derivatives are often studied for their potential applications in photodynamic therapy, solar energy conversion, and as sensors due to their unique optical properties. Overall, the structural complexity and functional groups present in this compound contribute to its diverse chemical behavior and potential utility in various fields of research and technology.
Formula:C40H46N4O8
InChI:InChI=1S/C40H46N4O8/c1-21-25(9-13-37(45)49-5)33-18-31-23(3)26(10-14-38(46)50-6)34(43-31)19-32-24(4)28(12-16-40(48)52-8)36(44-32)20-35-27(11-15-39(47)51-7)22(2)30(42-35)17-29(21)41-33/h17-20,41,44H,9-16H2,1-8H3/b29-17?,30-17-,31-18-,32-19-,33-18?,34-19?,35-20?,36-20-
InChI key:InChIKey=LBHYIBKOOKXTGC-IGIPUEBESA-N
SMILES:C(CC(OC)=O)C1=C2C=C3C(CCC(OC)=O)=C(C)C(=N3)C=C4NC(=CC5=NC(=CC(N2)=C1C)C(CCC(OC)=O)=C5C)C(CCC(OC)=O)=C4C
Synonyms:- 2,7,12,18-Porphinetetrapropionic acid, 3,8,13,17-tetramethyl-, tetramethyl ester
- 2,7,12,18-Tetramethyl 3,8,13,17-tetramethyl-21H,23H-porphine-2,7,12,18-tetrapropanoate
- 21H,23H-Porphine-2,7,12,18-tetrapropanoic acid, 3,8,13,17-tetramethyl-, 2,7,12,18-tetramethyl ester
- 21H,23H-Porphine-2,7,12,18-tetrapropanoic acid, 3,8,13,17-tetramethyl-, tetramethyl ester
- Coproporphyrin III tetramethyl ester
- Tetramethyl 3,3',3'',3'''-(3,8,13,17-Tetramethylporphyrin-2,7,12,18-Tetrayl)Tetrapropanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Coproporphyrin III-15N4 Tetramethyl Ester
CAS:Applications Coproporphyrin III-15N4 Tetramethyl Ester is a methyl ester derivative of Coproporphyrin III-15N4. Coproporphyrin I and III Tetramethyl Ester are nutritional requirements for the development of N. brasiliensis egg to third stage larvae. Coproporphyrin I and III Tetramethyl Ester are tetrapyrrole compounds excreted by Rhodobacter sphaeroides.
References Lida, K. et al.: Chem. Pharm. Bull., 55, 1067 (2007); Bolla, R. et al.: Comp. Biochem. Physiol. Part B, 48, 147 (1974)Formula:C40H4615N4O8Color and Shape:NeatMolecular weight:714.789

