CymitQuimica logo

CAS 55227-00-4

:

Boc-D-Glu-OMe

Description:
Boc-D-Glu-OMe, also known as Boc-protected D-glutamic acid methyl ester, is a derivative of glutamic acid, an amino acid that plays a crucial role in various biological processes. This compound features a tert-butyloxycarbonyl (Boc) protecting group, which is commonly used in peptide synthesis to protect the amino group, and a methyl ester group that protects the carboxylic acid functionality. The presence of these functional groups imparts specific characteristics to the molecule, such as increased stability and solubility in organic solvents. Boc-D-Glu-OMe is typically utilized in organic synthesis and peptide chemistry, particularly in the preparation of peptides where selective deprotection is required. Its structure allows for the introduction of further modifications, making it a versatile intermediate in the synthesis of more complex molecules. Additionally, it is important to handle this compound with care, as with many chemical substances, due to potential reactivity and safety considerations.
Formula:C11HNO6
InChI:InChI=1S/C11H19NO6/c1-11(2,3)18-10(16)12-7(9(15)17-4)5-6-8(13)14/h7H,5-6H2,1-4H3,(H,12,16)(H,13,14)/t7-/m1/s1
InChI key:ZAYAFKXUQMTLPL-SSDOTTSWSA-N
SMILES:CC(C)(C)OC(=O)N[C@H](CCC(=O)O)C(=O)OC
Found 4 products.