CAS 5523-37-5
:methyl (2S)-2-[(1E)-1-formylprop-1-en-1-yl]-1,2,6,7,12,12b-hexahydroindolo[2,3-a]quinolizine-3-carboxylate
Description:
Methyl (2S)-2-[(1E)-1-formylprop-1-en-1-yl]-1,2,6,7,12,12b-hexahydroindolo[2,3-a]quinolizine-3-carboxylate, with the CAS number 5523-37-5, is a complex organic compound characterized by its intricate structure, which includes a hexahydroindoloquinolizine framework. This compound features multiple functional groups, including a carboxylate ester and an aldehyde, contributing to its reactivity and potential biological activity. The stereochemistry indicated by the (2S) designation suggests specific spatial arrangements of atoms, which can influence the compound's interactions in biological systems. Its unique structure may allow for various applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the indole moiety is often associated with a range of biological activities, including antimicrobial and anticancer properties. As with many organic compounds, its solubility, stability, and reactivity can vary depending on environmental conditions, making it a subject of interest for further research in both synthetic and medicinal chemistry.
Formula:C21H22N2O3
InChI:InChI=1/C21H22N2O3/c1-3-13(12-24)16-10-19-20-15(14-6-4-5-7-18(14)22-20)8-9-23(19)11-17(16)21(25)26-2/h3-7,11-12,16,19,22H,8-10H2,1-2H3/b13-3-/t16-,19?/m0/s1
SMILES:C/C=C(/C=O)\[C@@H]1CC2c3c(CCN2C=C1C(=O)OC)c1ccccc1[nH]3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Vallesiachotamine
CAS:Vallesiachotamine, a recognized monoterpene indole alkaloid, exhibits anti-tumor activity [1].Formula:C21H22N2O3Color and Shape:SolidMolecular weight:350.41
