CAS 552330-87-7

6-bromocinnolin-4(1H)-one

Description:

6-Bromocinnolin-4(1H)-one is a heterocyclic organic compound characterized by its unique structure, which includes a bromine atom and a cinnolinone moiety. This compound features a fused bicyclic system consisting of a benzene ring and a pyridine-like ring, with a carbonyl group at the 4-position of the cinnoline structure. The presence of the bromine substituent at the 6-position significantly influences its chemical reactivity and properties, making it a subject of interest in medicinal chemistry and material science. Typically, compounds like 6-bromocinnolin-4(1H)-one exhibit biological activity, which may include antimicrobial or anticancer properties, although specific biological effects would depend on further empirical studies. Additionally, this compound may be utilized in various synthetic applications, including the development of pharmaceuticals or as a building block in organic synthesis. Its solubility, stability, and reactivity can vary based on the solvent and conditions used, making it essential to consider these factors in practical applications.

Formula: C₈H₅BrN₂O

InChI: InChI=1/C8H5BrN2O/c9-5-1-2-7-6(3-5)8(12)4-10-11-7/h1-4H,(H,11,12)

SMILES: c1cc2c(cc1Br)c(cnn2)O

6-Bromocinnolin-4(1H)-one

CAS: 552330-87-7

Formula: C₈H₅BrN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 225.0421

Ref: IN-DA00DBS3

6-Bromo-4(1H)-cinnolinone

CAS: 552330-87-7

6-Bromo-4(1H)-cinnolinone

Purity: 98%

Molecular weight: 225.05g/mol

Ref: 54-OR74966

6-Bromocinnolin-4(1H)-one

CAS: 552330-87-7

Formula: C₈H₅BrN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 225.045

Ref: 10-F231947