CAS 552331-06-3

6-BroMo-3-chloroisoquinoline

Description:

6-Bromo-3-chloroisoquinoline is a heterocyclic organic compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring. The presence of bromine and chlorine substituents at the 6 and 3 positions, respectively, contributes to its unique chemical properties and reactivity. This compound typically exhibits moderate to high lipophilicity, making it soluble in organic solvents while being less soluble in water. Its halogen substituents can influence its reactivity, allowing for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. The compound may also participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, due to the electrophilic nature of the halogen atoms. Additionally, its structural features may impart specific biological activities, making it a subject of interest in research related to drug discovery. As with many halogenated compounds, safety precautions should be taken when handling 6-bromo-3-chloroisoquinoline due to potential toxicity and environmental concerns.

Formula: C₉H₅BrClN

InChI: InChI=1/C9H5BrClN/c10-8-2-1-6-5-12-9(11)4-7(6)3-8/h1-5H

SMILES: c1cc(cc2cc(Cl)ncc12)Br

Synonyms:

• Isoquinoline, 6-bromo-3-chloro-

6-Bromo-3-chloroisoquinoline

CAS: 552331-06-3

Formula: C₉H₅BrClN

Purity: 97%

Color and Shape: Solid

Molecular weight: 242.4997

Ref: IN-DA0037OK

6-Bromo-3-chloroisoquinoline

CAS: 552331-06-3

Purity: 95%

Molecular weight: 242.5

Ref: FT-I11568

6-Bromo-3-chloroisoquinoline

CAS: 552331-06-3

6-Bromo-3-chloroisoquinoline

Formula: C₉H₅BrClN

Purity: 97%

Color and Shape: pale yellow solid

Molecular weight: 242.50g/mol

Ref: 54-OR40220

6-Bromo-3-chloroisoquinoline

CAS: 552331-06-3

Formula: C₉H₅BrClN

Purity: 97%

Color and Shape: Solid

Molecular weight: 242.5

Ref: 10-F078476