CAS 55234-56-5

4-(4-methoxyphenyl)-4-oxobutanenitrile

Description:

4-(4-Methoxyphenyl)-4-oxobutanenitrile, with the CAS number 55234-56-5, is an organic compound characterized by its functional groups, including a nitrile and a ketone. This compound features a butanenitrile backbone with a methoxy-substituted phenyl group, which contributes to its chemical properties and reactivity. The presence of the methoxy group enhances its solubility in organic solvents and may influence its electronic properties, making it a potential candidate for various applications in organic synthesis and medicinal chemistry. The nitrile group can participate in nucleophilic reactions, while the ketone functionality can undergo various transformations, such as reduction or condensation reactions. Additionally, the compound's structure suggests potential for interactions with biological targets, which may be explored in drug development. Overall, 4-(4-methoxyphenyl)-4-oxobutanenitrile is a versatile compound with interesting chemical behavior due to its unique structural features.

Formula: C₁₁H₁₁NO₂

InChI: InChI=1/C11H11NO2/c1-14-10-6-4-9(5-7-10)11(13)3-2-8-12/h4-7H,2-3H2,1H3

SMILES: COc1ccc(cc1)C(=O)CCC#N

4-(4-Methoxyphenyl)-4-oxobutanenitrile

CAS: 55234-56-5

4-(4-Methoxyphenyl)-4-oxobutanenitrile

Purity: 95%

Molecular weight: 189.21g/mol

Ref: 54-OR33190

4-(4-Methoxyphenyl)-4-oxobutyronitrile

CAS: 55234-56-5

Formula: C₁₁H₁₁NO₂

Purity: 97.0%

Molecular weight: 189.214

Ref: 10-F206958

4-(4-Methoxyphenyl)-4-oxobutanenitrile

CAS: 55234-56-5

Versatile small molecule scaffold

Formula: C₁₁H₁₁NO₂

Purity: Min. 95%

Molecular weight: 189.21 g/mol

Ref: 3D-FCA23456