CAS 55240-51-2: 2-phenylpyridine-4-carboxylic acid

Description:2-Phenylpyridine-4-carboxylic acid, with the CAS number 55240-51-2, is an organic compound that features a pyridine ring substituted with a phenyl group and a carboxylic acid functional group. This compound typically exhibits characteristics common to aromatic carboxylic acids, such as being a solid at room temperature and having a relatively high melting point. It is soluble in polar solvents like water and alcohols, while being less soluble in non-polar solvents. The presence of both the phenyl and carboxylic acid groups contributes to its potential as a ligand in coordination chemistry and its utility in organic synthesis. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its reactivity and interactions with other molecules. Overall, 2-phenylpyridine-4-carboxylic acid is a versatile compound with applications in both academic and industrial chemistry.

Formula:C₁₂H₉NO₂

InChI:InChI=1/C12H9NO2/c14-12(15)10-6-7-13-11(8-10)9-4-2-1-3-5-9/h1-8H,(H,14,15)

Synonyms:
2-Phenylisonicotinic acid
2-Phenyl-isonicotinic acid
4-Pyridinecarboxylic Acid, 2-Phenyl-

Found 5 products.

Product data	Purity	Price range	Estimated delivery
2-Phenylpyridine-4-carboxylic Acid REF: 3B-P2453CAS: 55240-51-2	>98.0%(GC)(T)	179.00 €	Mon 07 Apr 25
2-(Phenyl)-isonicotinic acid REF: 10-F061099CAS: 55240-51-2	95.0%	32.00 €~301.00 €	Tue 08 Apr 25
2-Phenylisonicotinic acid REF: IN-DA003HVNCAS: 55240-51-2	98%	44.00 €~210.00 €	Mon 14 Apr 25
2-Phenylisonicotinic acid REF: 54-OR2592CAS: 55240-51-2	98%	82.00 €~156.00 €	Tue 15 Apr 25
2-Phenylisonicotinic acid REF: 3D-FP127942CAS: 55240-51-2	Min. 95%	- - -	Discontinued product