CAS 55240-51-2: 2-phenylpyridine-4-carboxylic acid
Description:2-Phenylpyridine-4-carboxylic acid, with the CAS number 55240-51-2, is an organic compound that features a pyridine ring substituted with a phenyl group and a carboxylic acid functional group. This compound typically exhibits characteristics common to aromatic carboxylic acids, such as being a solid at room temperature and having a relatively high melting point. It is soluble in polar solvents like water and alcohols, while being less soluble in non-polar solvents. The presence of both the phenyl and carboxylic acid groups contributes to its potential as a ligand in coordination chemistry and its utility in organic synthesis. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its reactivity and interactions with other molecules. Overall, 2-phenylpyridine-4-carboxylic acid is a versatile compound with applications in both academic and industrial chemistry.
Formula:C12H9NO2
InChI:InChI=1/C12H9NO2/c14-12(15)10-6-7-13-11(8-10)9-4-2-1-3-5-9/h1-8H,(H,14,15)
- Synonyms:
- 2-Phenylisonicotinic acid
- 2-Phenyl-isonicotinic acid
- 4-Pyridinecarboxylic Acid, 2-Phenyl-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-Phenylpyridine-4-carboxylic Acid REF: 3B-P2453CAS: 55240-51-2 | >98.0%(GC)(T) | 179.00 € | Tue 05 Aug 25 |
![]() | 2-(Phenyl)-isonicotinic acid REF: 10-F061099CAS: 55240-51-2 | 95.0% | 32.00 €~301.00 € | Fri 08 Aug 25 |
![]() | 2-Phenylisonicotinic acid REF: IN-DA003HVNCAS: 55240-51-2 | 98% | 43.00 €~212.00 € | Tue 12 Aug 25 |
![]() | 2-Phenylisonicotinic acid REF: 54-OR2592CAS: 55240-51-2 | 98% | 82.00 €~156.00 € | Wed 13 Aug 25 |
![]() | 2-Phenylisonicotinic acid REF: 3D-FP127942CAS: 55240-51-2 | Min. 95% | - - - | Discontinued product |

2-Phenylpyridine-4-carboxylic Acid
Ref: 3B-P2453
1g | 179.00 € |

2-(Phenyl)-isonicotinic acid
Ref: 10-F061099
1g | 91.00 € | ||
5g | 301.00 € | ||
100mg | 32.00 € | ||
250mg | 39.00 € |

2-Phenylisonicotinic acid
Ref: IN-DA003HVN
1g | 109.00 € | ||
100mg | 43.00 € | ||
250mg | 46.00 € |

2-Phenylisonicotinic acid
Ref: 54-OR2592
1g | 156.00 € | ||
250mg | 82.00 € |

2-Phenylisonicotinic acid
Ref: 3D-FP127942
1g | Discontinued | Request information | |
500mg | Discontinued | Request information |