CAS 55255-74-8
:[2-(cyclohexylmethyl)pentadecyl]cyclohexane
Description:
[2-(Cyclohexylmethyl)pentadecyl]cyclohexane, with the CAS number 55255-74-8, is an organic compound characterized by its complex hydrocarbon structure. This substance features a cyclohexane ring and a long pentadecyl chain, which contributes to its hydrophobic properties. The presence of cyclohexylmethyl groups enhances its molecular stability and influences its physical properties, such as melting and boiling points. Typically, compounds of this nature exhibit low solubility in water due to their non-polar characteristics, making them more soluble in organic solvents. They may also demonstrate interesting thermal and mechanical properties, which can be advantageous in various applications, including lubricants, surfactants, or additives in polymer formulations. Additionally, the structural features may impart unique interactions with biological systems, warranting further investigation into their potential uses in pharmaceuticals or materials science. Overall, the characteristics of this compound are defined by its hydrophobic nature, structural complexity, and potential utility in various industrial applications.
Formula:C28H54
InChI:InChI=1/C28H54/c1-2-3-4-5-6-7-8-9-10-11-14-23-28(24-26-19-15-12-16-20-26)25-27-21-17-13-18-22-27/h26-28H,2-25H2,1H3
Synonyms:- Cyclohexane, 1,1'- (2-tridecyl-1,3-propanediyl)bis-
- [2-(Cyclohexylmethyl)pentadecyl]cyclohexane
- cyclohexane, 1,1'-(2-tridecyl-1,3-propanediyl)bis-
- 1-Cyclohexyl-2-(cyclohexylmethyl)pentadecane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.


