CAS 55256-49-0

4,6-dihydroxy-3a,12a-dihydro-5H-furo[3',2':4,5]furo[3,2-b]xanthen-5-one

Description:

4,6-Dihydroxy-3a,12a-dihydro-5H-furo[3',2':4,5]furo[3,2-b]xanthen-5-one, with CAS number 55256-49-0, is a synthetic organic compound characterized by its complex polycyclic structure, which includes multiple fused rings and hydroxyl functional groups. This compound exhibits notable solubility in organic solvents and is often studied for its potential applications in fields such as organic electronics, dyes, and photonic materials due to its unique optical properties. The presence of hydroxyl groups contributes to its reactivity and potential for hydrogen bonding, influencing its interactions in various chemical environments. Additionally, the compound may exhibit fluorescence, making it of interest in photochemical studies. Its structural features suggest that it could participate in various chemical reactions, including oxidation and reduction processes. Overall, 4,6-dihydroxy-3a,12a-dihydro-5H-furo[3',2':4,5]furo[3,2-b]xanthen-5-one is a versatile compound with potential utility in advanced material science and organic synthesis.

Formula: C₁₇H₁₀O₆

InChI: InChI=1/C17H10O6/c18-8-2-1-3-9-13(8)16(20)14-11(22-9)6-10-12(15(14)19)7-4-5-21-17(7)23-10/h1-7,17-19H

SMILES: c1cc(c2c(c1)oc1cc3c(C4C=COC4O3)c(c1c2=O)O)O

Sterigmatin

CAS: 55256-49-0

Sterigmatin

Purity: >74%

Color and Shape: Solid

Molecular weight: 310.26g/mol

Ref: 54-BIBR1095