CAS 55270-72-9

(2-Chlorophenyl)[4-(methylthio)phenyl]methanone

Description:

(2-Chlorophenyl)[4-(methylthio)phenyl]methanone, with the CAS number 55270-72-9, is an organic compound characterized by its complex structure, which includes a chlorophenyl group and a methylthio-substituted phenyl group attached to a carbonyl (ketone) functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and relatively high melting and boiling points compared to aliphatic compounds. The presence of the chlorine atom and the methylthio group can influence its reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. Additionally, the compound may exhibit biological activity, which is common among substituted phenyl ketones, and could be of interest in pharmaceutical research. Its solubility is likely to be moderate in organic solvents, and it may show limited solubility in water due to the hydrophobic nature of the aromatic rings. Overall, this compound's unique functional groups and structure contribute to its potential applications in organic synthesis and medicinal chemistry.

Formula: C₁₄H₁₁ClOS

InChI: InChI=1/C14H11ClOS/c1-17-11-8-6-10(7-9-11)14(16)12-4-2-3-5-13(12)15/h2-9H,1H3

InChI key: InChIKey=IZXCWJGLUDZSPG-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C=CC=C1)C2=CC=C(SC)C=C2

Synonyms:

• (2-Chlorophenyl)-(4-methylsulfanylphenyl)methanone
• (2-Chlorophenyl)[4-(methylthio)phenyl]methanone
• 2-Chloro-4′-(methylthio)benzophenone
• Methanone, (2-Chlorophenyl)[4-(Methylthio)Phenyl]-
• (2-Chlorophenyl)[4-(methylsulfanyl)phenyl]methanone

2-Chloro-4′-(methylthio)benzophenone

CAS: 55270-72-9

Formula: C₁₄H₁₁ClOS

Purity: 97.0%

Molecular weight: 262.75

Ref: 10-F202230