CAS 55275-61-1
:α-(Aminomethyl)-4-methoxybenzenemethanol
Description:
α-(Aminomethyl)-4-methoxybenzenemethanol, also known by its CAS number 55275-61-1, is an organic compound characterized by the presence of an amino group and a methoxy group attached to a benzene ring. This compound features a phenolic structure, which contributes to its potential reactivity and solubility in various solvents. The amino group can participate in hydrogen bonding, enhancing its solubility in polar solvents, while the methoxy group can influence its electronic properties and steric hindrance. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of drugs or as intermediates in organic synthesis. Additionally, the presence of both hydrophilic and hydrophobic groups indicates that it may interact with biological membranes, which could be relevant for its pharmacokinetic properties. Overall, α-(Aminomethyl)-4-methoxybenzenemethanol is a versatile compound with potential implications in various fields, including medicinal chemistry and materials science.
Formula:C9H13NO2
InChI:InChI=1S/C9H13NO2/c1-12-8-4-2-7(3-5-8)9(11)6-10/h2-5,9,11H,6,10H2,1H3
InChI key:InChIKey=LQEPONWCAMNCOY-UHFFFAOYSA-N
SMILES:C(CN)(O)C1=CC=C(OC)C=C1
Synonyms:- 1-(4-Methoxyphenyl)-2-aminoethanol
- 2-Amino-1-(4-Methoxyphenyl)Ethanol
- 2-Amino-1-(4-methoxyphenyl)ethan-1-ol
- 2-Hydroxy-2-(4-methoxyphenyl)ethylamine
- Benzenemethanol, α-(aminomethyl)-4-methoxy-
- alpha-(Aminomethyl)-4-methoxybenzyl alcohol
- p-Anisyl alcohol, α-(aminomethyl)-
- α-(Aminomethyl)-4-methoxybenzenemethanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Amino-1-(4-methoxyphenyl)ethan-1-ol
CAS:2-Amino-1-(4-methoxyphenyl)ethan-1-olPurity:≥95%Molecular weight:167.21g/molα-(Aminomethyl)-p-anisyl Alcohol
CAS:Controlled ProductFormula:C9H13NO2Color and Shape:NeatMolecular weight:167.2052-Amino-1-(4-methoxyphenyl)ethanol
CAS:2-Amino-1-(4-methoxyphenyl)ethanol is a lactam that is minimally reactive with biological systems. It has been shown to inhibit the binding of the linker molecule to calcitriol, which is a vital component of vitamin D synthesis. This compound can also be used in intra-articular injections for the treatment of arthritis and other inflammatory disorders. 2-Amino-1-(4-methoxyphenyl)ethanol has been synthesized from an endogenous amino acid precursor and conjugated with a fluorophore, enabling it to be tracked in vivo by fluorescence imaging. It has been demonstrated that 2-Amino-1-(4-methoxyphenyl)ethanol can be used as a traceless bioactive molecule in molecular modelling and simulations.
Formula:C9H13NO2Purity:Min. 95%Molecular weight:167.21 g/mol


