CAS 552845-84-8

2-(5-bromo-2,4-dimethoxyphenyl)-1,3-dioxolane

Description:

2-(5-bromo-2,4-dimethoxyphenyl)-1,3-dioxolane is an organic compound characterized by its unique structural features, including a dioxolane ring and a brominated aromatic substituent. The presence of the dioxolane moiety suggests that this compound may exhibit properties typical of cyclic ethers, such as increased stability and potential reactivity in nucleophilic substitution reactions. The bromine atom introduces a halogen, which can enhance the compound's reactivity and influence its electronic properties, while the dimethoxy groups contribute to its overall polarity and solubility in organic solvents. This compound may be of interest in medicinal chemistry and materials science due to its potential biological activity and utility in synthetic pathways. Additionally, the presence of multiple functional groups allows for further derivatization, making it a versatile building block in organic synthesis. As with many brominated compounds, considerations regarding environmental impact and safety are essential during handling and application.

Formula: C₁₁H₁₃BrO₄

InChI: InChI=1/C11H13BrO4/c1-13-9-6-10(14-2)8(12)5-7(9)11-15-3-4-16-11/h5-6,11H,3-4H2,1-2H3

SMILES: COc1cc(c(cc1C1OCCO1)Br)OC

1-bromo-2,4-dimethoxy-5-(1,3-dioxolan-2-yl)benzene

CAS: 552845-84-8

Formula: C₁₁H₁₃BrO₄

Purity: 95%

Molecular weight: 289.1225

Ref: IN-DA00DG3I

1-bromo-2,4-dimethoxy-5-(1,3-dioxolan-2-yl)benzene

CAS: 552845-84-8

Formula: C₁₁H₁₃BrO₄

Purity: 95.0%

Molecular weight: 289.125

Ref: 10-F208281