CAS 55285-34-2
:2-[[4-(1-Methylethyl)phenyl]amino]-3-pyridinecarboxylic acid
Description:
2-[[4-(1-Methylethyl)phenyl]amino]-3-pyridinecarboxylic acid, with the CAS number 55285-34-2, is an organic compound characterized by its complex structure, which includes a pyridine ring and an amine group. This substance typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the carboxylic acid functional group. The presence of the isopropyl group on the phenyl ring contributes to its hydrophobic characteristics, influencing its solubility and reactivity. This compound may be of interest in pharmaceutical applications, particularly in the development of drugs targeting specific biological pathways, owing to its ability to interact with various biological molecules. Additionally, its structural features suggest potential for diverse chemical reactivity, including electrophilic substitution and nucleophilic attack, making it a candidate for further synthetic modifications. Overall, the compound's unique combination of functional groups and structural elements positions it as a valuable subject for research in medicinal chemistry and related fields.
Formula:C15H16N2O2
InChI:InChI=1S/C15H16N2O2/c1-10(2)11-5-7-12(8-6-11)17-14-13(15(18)19)4-3-9-16-14/h3-10H,1-2H3,(H,16,17)(H,18,19)
InChI key:InChIKey=DCLXMHUTJZKNCY-UHFFFAOYSA-N
SMILES:N(C1=C(C(O)=O)C=CC=N1)C2=CC=C(C(C)C)C=C2
Synonyms:- 2-(4-Isopropyl-anilino)-nicotinic acid
- 2-[[4-(1-Methylethyl)phenyl]amino]-3-pyridinecarboxylic acid
- 2-[[4-(Propan-2-yl)phenyl]amino]pyridine-3-carboxylic acid
- 2-(4-Propan-2-ylanilino)pyridine-3-carboxylic acid
- 3-Pyridinecarboxylic acid, 2-[[4-(1-methylethyl)phenyl]amino]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-[(4-Isopropylphenyl)amino]nicotinic acid
CAS:2-[(4-Isopropylphenyl)amino]nicotinic acid is a fine chemical, useful building block, research chemicals, reagent, speciality chemical and a versatile building block. It is an intermediate in organic synthesis and can be used to form many types of compounds. This compound also has many applications in the field of chemistry including use as a reaction component or as a scaffold. 2-[(4-Isopropylphenyl)amino]nicotinic acid is used in the production of pharmaceuticals, pesticides and other industrial chemicals.Formula:C15H16N2O2Purity:Min. 95%Color and Shape:Yellow PowderMolecular weight:256.3 g/mol
