CAS 55287-49-5
:N-[(2S,3S,4R,5S)-2,4-dibenzyloxy-6-(benzyloxymethyl)-5-hydroxy-tetrahydropyran-3-yl]acetamide
Description:
N-[(2S,3S,4R,5S)-2,4-dibenzyloxy-6-(benzyloxymethyl)-5-hydroxy-tetrahydropyran-3-yl]acetamide, with CAS number 55287-49-5, is a complex organic compound characterized by its tetrahydropyran structure, which features multiple stereocenters contributing to its chiral nature. This compound contains both acetamide and benzyloxy functional groups, indicating potential for hydrogen bonding and hydrophobic interactions, which may influence its solubility and reactivity. The presence of multiple benzyl groups suggests that it may exhibit significant lipophilicity, potentially affecting its biological activity and pharmacokinetics. The hydroxyl group in the structure can participate in hydrogen bonding, enhancing its solubility in polar solvents. This compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development or as a synthetic intermediate. Its stereochemistry and functional groups could also play a crucial role in determining its interactions with biological targets, making it a subject of interest for further research in the fields of organic and medicinal chemistry.
Formula:C29H33NO6
InChI:InChI=1/C29H33NO6/c1-21(31)30-26-28(34-18-23-13-7-3-8-14-23)27(32)25(20-33-17-22-11-5-2-6-12-22)36-29(26)35-19-24-15-9-4-10-16-24/h2-16,25-29,32H,17-20H2,1H3,(H,30,31)/t25?,26-,27+,28+,29-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N-((2S,3R,4R,5S,6R)-2,4-Bis(benzyloxy)-6-((benzyloxy)methyl)-5-hydroxytetrahydro-2H-pyran-3-yl)acetamide
CAS:Formula:C29H33NO6Color and Shape:SolidMolecular weight:491.5754Benzyl-2-acetamido-2-deoxy-3,6-di-O-benzyl-α-D-glucopyranoside
CAS:Benzyl-2-acetamido-2-deoxy-3,6-di-O-benzyl-α-D-glucopyranosidePurity:≥95%Color and Shape:Off-White SolidBenzyl 2-Acetamido-2-deoxy-3,6-di-O-benzyl-α-D-glucopyranoside
CAS:Controlled Product<p>Applications Benzyl 2-Acetamido-2-deoxy-3,6-di-O-benzyl-α-D-glucopyranoside (cas# 55287-49-5) is a compound useful in organic synthesis.<br></p>Formula:C29H33NO6Color and Shape:NeatMolecular weight:491.582-Acetamido-1,3,6-tri-O-benzyl-2-deoxy-a-D-glucopyranoside
CAS:<p>2-Acetamido-1,3,6-tri-O-benzyl-2-deoxy-a-D-glucopyranoside is a carbohydrate that is composed of four sugar units. It is an antigenic determinant found on the surface of human erythrocytes. The chemical synthesis of this substance begins with the condensation reaction between D-glucose and 2,4,6,-trinitrophenylacetic acid followed by benzylation and acetylation. This compound belongs to the group of substances known as carbohydrates which are chains of monosaccharides that form glycosidic bonds with other sugars. These chains are classified according to their length and the number of sugar units they contain: trioses (three sugar units), tetroses (four sugar units), pentoses (five sugar units), hexoses (six sugar units) or heptoses (seven sugar).</p>Formula:C29H33NO6Purity:Min. 95%Molecular weight:491.58 g/mol




