
CAS 55294-15-0
:Muzolimine
Description:
Muzolimine is a chemical compound classified as a thienobenzodiazepine derivative, primarily known for its pharmacological properties. It is characterized by its ability to act as a central nervous system stimulant and has been investigated for its potential use in treating various conditions, including depression and anxiety disorders. The molecular structure of Muzolimine features a benzodiazepine core, which is known for its interaction with the gamma-aminobutyric acid (GABA) receptors, contributing to its psychoactive effects. The compound is typically administered in specific dosages to achieve therapeutic effects while minimizing side effects. Its solubility, stability, and reactivity are influenced by its chemical structure, making it important to consider these factors in formulation and application. As with many pharmaceuticals, the safety profile, including potential side effects and contraindications, is crucial for its use in clinical settings. Ongoing research continues to explore its efficacy and mechanisms of action, contributing to the understanding of its role in pharmacotherapy.
Formula:C11H11Cl2N3O
InChI:InChI=1S/C11H11Cl2N3O/c1-6(16-11(17)5-10(14)15-16)7-2-3-8(12)9(13)4-7/h2-4,6H,5H2,1H3,(H2,14,15)
InChI key:InChIKey=RLWRMIYXDPXIEX-UHFFFAOYSA-N
SMILES:C(C)(N1C(=O)CC(N)=N1)C2=CC(Cl)=C(Cl)C=C2
Synonyms:- Muzolimine
- BAY-g 2821
- 3H-Pyrazol-3-one, 5-amino-2-[1-(3,4-dichlorophenyl)ethyl]-2,4-dihydro-
- 5-Amino-2-[1-(3,4-dichlorophenyl)ethyl]-2,4-dihydro-3H-pyrazol-3-one
- Edrul
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Muzolimine
CAS:Muzolimine: a long-acting, high-capacity diuretic for kidney failure/hypertension; withdrawn due to serious neurological side effects.Formula:C11H11Cl2N3OColor and Shape:SolidMolecular weight:272.13
