CymitQuimica logo

CAS 55298-62-9

:

ethyl (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19Z,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(3-amino-3,6-dideoxy-beta-D-mannopyranosyl)oxy]-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,3

Description:
The chemical substance with the name "ethyl (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19Z,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(3-amino-3,6-dideoxy-beta-D-mannopyranosyl)oxy]-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,3" and CAS number "55298-62-9" is a complex organic compound characterized by its intricate stereochemistry and multiple functional groups. It features a bicyclic structure with numerous hydroxyl groups, indicating high polarity and potential for hydrogen bonding. The presence of an amino sugar moiety suggests biological relevance, possibly as a glycoside or in medicinal chemistry applications. The compound's multiple double bonds and stereocenters contribute to its potential reactivity and specificity in biological systems. Its octahydroxy nature implies significant solubility in polar solvents, while the ethyl group may enhance lipophilicity, influencing its pharmacokinetic properties. Overall, this compound's structural complexity and functional diversity make it a subject of interest in fields such as organic synthesis, medicinal chemistry, and biochemistry.
Formula:C49H77NO17
InChI:InChI=1/C49H77NO17/c1-6-63-47(61)42-39(56)28-49(62)27-35(53)24-38(55)37(54)22-21-33(51)23-34(52)25-41(57)64-31(4)30(3)44(58)29(2)19-17-15-13-11-9-7-8-10-12-14-16-18-20-36(26-40(42)67-49)66-48-46(60)43(50)45(59)32(5)65-48/h7-20,29-40,42-46,48,51-56,58-60,62H,6,21-28,50H2,1-5H3/b8-7+,11-9+,12-10+,15-13+,16-14+,19-17-,20-18+/t29-,30-,31-,32+,33+,34+,35-,36-,37+,38+,39-,40-,42+,43-,44+,45+,46-,48-,49+/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.