CAS 553-58-2
:2-[(2-methylpropyl)amino]ethyl 3-aminobenzoate hydrochloride (1:1)
Description:
2-[(2-methylpropyl)amino]ethyl 3-aminobenzoate hydrochloride, with the CAS number 553-58-2, is a chemical compound that belongs to the class of amino acid derivatives. It is characterized by the presence of an amino group, which contributes to its basicity and potential for forming salts, such as the hydrochloride form. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt, which enhances its solubility compared to its free base form. The structure includes a 3-aminobenzoate moiety, which may impart biological activity, making it of interest in pharmaceutical applications. Its properties, such as melting point and specific reactivity, can vary based on purity and environmental conditions. As with many amine-containing compounds, it may exhibit basicity, allowing it to participate in acid-base reactions. Safety data should be consulted for handling, as it may pose health risks if not managed properly.
Formula:C13H21ClN2O2
InChI:InChI=1/C13H20N2O2.ClH/c1-10(2)9-15-6-7-17-13(16)11-4-3-5-12(14)8-11;/h3-5,8,10,15H,6-7,9,14H2,1-2H3;1H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
