CAS 553-65-1
:Ethanol, 2-[[2-(diethylamino)ethyl]ethylamino]-, 1-(4-aminobenzoate)
Description:
The chemical substance known as Ethanol, 2-[[2-(diethylamino)ethyl]ethylamino]-, 1-(4-aminobenzoate), with the CAS number 553-65-1, is a complex organic compound that features a combination of an ethanol backbone and a diethylamino group. This compound is characterized by its amine functionalities, which contribute to its basicity and potential for forming hydrogen bonds. The presence of the 4-aminobenzoate moiety suggests that it may exhibit properties related to both aromaticity and potential interactions with biological systems. Ethanol derivatives often have applications in pharmaceuticals, where they can act as intermediates or active pharmaceutical ingredients. The compound's solubility in polar solvents, such as water and alcohols, is likely due to the presence of both hydrophilic amine groups and the ethanol structure. Additionally, the diethylamino group may impart lipophilicity, influencing the compound's behavior in biological systems. Overall, this substance's unique structure suggests potential utility in various chemical and medicinal applications.
Formula:C17H29N3O2
InChI:InChI=1S/C17H29N3O2/c1-4-19(5-2)11-12-20(6-3)13-14-22-17(21)15-7-9-16(18)10-8-15/h7-10H,4-6,11-14,18H2,1-3H3
InChI key:InChIKey=GFFFJSWQOUVZCY-UHFFFAOYSA-N
SMILES:C(OCCN(CCN(CC)CC)CC)(=O)C1=CC=C(N)C=C1
Synonyms:- Amoxecaine
- Ethanol, 2-[[2-(diethylamino)ethyl]ethylamino]-, 1-(4-aminobenzoate)
- Ethanol, 2-[[2-(diethylamino)ethyl]ethylamino]-, p-aminobenzoate (ester)
- 2856RP
- Ethanol, 2-[[2-(diethylamino)ethyl]ethylamino]-, 4-aminobenzoate (ester)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Amoxecaine
CAS:Amoxecaine is a Local Anesthetic.Formula:C17H29N3O2Color and Shape:SolidMolecular weight:307.43
