CAS 55303-92-9

11-hydroxy-3-[(1S)-1-hydroxy-3-methylbutyl]-4-methoxy-9-methyl-5H,7H-dibenzo[b,g][1,5]dioxocin-5-one

Description:

11-hydroxy-3-[(1S)-1-hydroxy-3-methylbutyl]-4-methoxy-9-methyl-5H,7H-dibenzo[b,g][1,5]dioxocin-5-one, with CAS number 55303-92-9, is a complex organic compound characterized by its unique structural features, including multiple hydroxyl groups and a methoxy group, which contribute to its potential biological activity. This compound belongs to the class of dibenzo[dioxocin] derivatives, which are known for their diverse pharmacological properties. The presence of stereocenters, particularly in the (1S)-1-hydroxy-3-methylbutyl moiety, suggests that it may exhibit chirality, potentially influencing its interactions with biological targets. The compound's structure may facilitate various intermolecular interactions, such as hydrogen bonding and π-π stacking, which can affect its solubility and reactivity. While specific biological activities and applications may vary, compounds of this nature are often investigated for their potential therapeutic effects in medicinal chemistry. Further studies would be necessary to elucidate its full range of properties and potential uses in pharmaceuticals or other fields.

Formula: C₂₁H₂₄O₆

InChI: InChI=1/C21H24O6/c1-11(2)7-15(22)14-5-6-17-18(20(14)25-4)21(24)26-10-13-8-12(3)9-16(23)19(13)27-17/h5-6,8-9,11,15,22-23H,7,10H2,1-4H3/t15-/m0/s1

SMILES: CC(C)C[C@@H](c1ccc2c(c1OC)C(=O)OCc1cc(C)cc(c1O2)O)O

Synonyms:

• 5H,7H-Dibenzo(b,g)(1,5)dioxocin-5-one, 11-hydroxy-3-(1-hydroxy-3-methylbutyl)-4-methoxy-9-methyl-, (S)-
• 5H,7H-dibenzo[b,g][1,5]dioxocin-5-one, 11-hydroxy-3-[(1S)-1-hydroxy-3-methylbutyl]-4-methoxy-9-methyl-

Penicillide

CAS: 55303-92-9

Penicillide: fungal metabolite, inhibits calpain 2/ACAT (IC50 = 7.1/22.9 μM), blocks oxytocin receptors (IC50 = 67 μM), stops RNA synthesis in P388 cells.

Formula: C₂₁H₂₄O₆

Color and Shape: Solid

Molecular weight: 372.417

Ref: TM-T36931

Penicillide

CAS: 55303-92-9

Formula: C₂₁H₂₄O₆

Molecular weight: 372.4

Ref: 7W-GL8408