CAS 55303-99-6
:(+)-Avarone
Description:
(+)-Avarone, with the CAS number 55303-99-6, is a naturally occurring compound classified as a sesquiterpene. It is primarily derived from the plant species of the genus Avaria, known for its medicinal properties. This compound exhibits a complex molecular structure characterized by multiple rings and functional groups, contributing to its unique chemical behavior. (+)-Avarone is recognized for its potential biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in pharmacological research. The compound is typically found in a solid state at room temperature and is soluble in organic solvents. Its stereochemistry, indicated by the (+) designation, suggests that it has a specific three-dimensional arrangement that can influence its interaction with biological targets. As with many natural products, the study of (+)-Avarone encompasses its synthesis, extraction, and potential applications in medicine and industry, highlighting the importance of understanding its chemical characteristics for further development.
Formula:C21H28O2
InChI:InChI=1S/C21H28O2/c1-14-6-5-7-19-20(14,3)11-10-15(2)21(19,4)13-16-12-17(22)8-9-18(16)23/h6,8-9,12,15,19H,5,7,10-11,13H2,1-4H3/t15-,19+,20+,21+/m0/s1
InChI key:InChIKey=VPRHEJGLNUDEEH-LWILDLIXSA-N
SMILES:C([C@@]1(C)[C@]2([C@](C)(CC[C@@H]1C)C(C)=CCC2)[H])C=3C(=O)C=CC(=O)C3
Synonyms:- 2,5-Cyclohexadiene-1,4-dione, 2-[(1,2,3,4,4a,7,8,8a-octahydro-1,2,4a,5-tetramethyl-1-naphthalenyl)methyl]-, [1R-(1α,2β,4aβ,8aα)]-
- 2,5-Cyclohexadiene-1,4-dione, 2-[[(1R,2S,4aS,8aS)-1,2,3,4,4a,7,8,8a-octahydro-1,2,4a,5-tetramethyl-1-naphthalenyl]methyl]-
- 2-[(1,2,4A,5-Tetramethyl-1,2,3,4,4A,7,8,8A-Octahydronaphthalen-1-Yl)Methyl]Cyclohexa-2,5-Diene-1,4-Dione
- 2-[[(1R,2S,4aS,8aS)-1,2,3,4,4a,7,8,8a-Octahydro-1,2,4a,5-tetramethyl-1-naphthalenyl]methyl]-2,5-cyclohexadiene-1,4-dione
- 2-{[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-yl]methyl}cyclohexa-2,5-diene-1,4-dione
- 2-{[(1R,8aS)-1,2,4a,5-tetramethyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-yl]methyl}cyclohexa-2,5-diene-1,4-dione
- Avarone
- Ls-56284
- NSC 607774
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

