CAS 55304-06-8

4-(Acetylamino)-5-bromo-2-methoxybenzoic acid

Description:

4-(Acetylamino)-5-bromo-2-methoxybenzoic acid, with the CAS number 55304-06-8, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with an acetylamino group, a bromo atom, and a methoxy group. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid group and the amine. The bromine substitution introduces a halogen, which can influence the compound's reactivity and solubility in various solvents. The methoxy group contributes to the compound's overall polarity and can affect its interaction with biological systems. This compound may be of interest in pharmaceutical research due to its potential biological activity, particularly in the context of drug design and development. Its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as recrystallization or chromatography. Overall, 4-(Acetylamino)-5-bromo-2-methoxybenzoic acid represents a versatile building block in organic synthesis and medicinal chemistry.

Formula: C₁₀H₁₀BrNO₄

InChI: InChI=1S/C10H10BrNO4/c1-5(13)12-8-4-9(16-2)6(10(14)15)3-7(8)11/h3-4H,1-2H3,(H,12,13)(H,14,15)

InChI key: InChIKey=LUTDQTHHBVGSRS-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(OC)C=C(NC(C)=O)C(Br)=C1

Synonyms:

• Benzoic acid, 4-(acetylamino)-5-bromo-2-methoxy-
• 4-Acetamino-5-bromo-2-methoxybenzoic acid
• 4-(Acetylamino)-5-bromo-2-methoxybenzoic acid

Bromopride Impurity 7

CAS: 55304-06-8

Formula: C₁₀H₁₀BrNO₄

Molecular weight: 288.10

Ref: 4Z-B-1914