CAS 55304-17-1
:N-Hydroxymexiletine
Description:
N-Hydroxymexiletine is a chemical compound that serves as a derivative of mexiletine, which is primarily used as an antiarrhythmic agent. This substance is characterized by the presence of a hydroxyl group (-OH) attached to the nitrogen atom of the mexiletine structure, which enhances its pharmacological properties. N-Hydroxymexiletine exhibits a moderate solubility in polar solvents, reflecting its potential for bioavailability in biological systems. The compound is known to interact with sodium channels, similar to its parent compound, and may exhibit antiarrhythmic effects. Its molecular structure contributes to its stability and reactivity, making it a subject of interest in medicinal chemistry. Additionally, N-Hydroxymexiletine may undergo metabolic transformations in the body, influencing its therapeutic efficacy and safety profile. As with many chemical substances, understanding its characteristics, including its pharmacokinetics and potential side effects, is crucial for its application in clinical settings.
Formula:C11H17NO2
InChI:InChI=1S/C11H17NO2/c1-8-5-4-6-9(2)11(8)14-7-10(3)12-13/h4-6,10,12-13H,7H2,1-3H3
InChI key:InChIKey=ABMUWCMGKRQAIK-UHFFFAOYSA-N
SMILES:O(CC(NO)C)C1=C(C)C=CC=C1C
Synonyms:- 1-(2,6-Dimethylphenoxy)-N-hydroxy-2-propanamine
- 2-Propanamine, 1-(2,6-dimethylphenoxy)-N-hydroxy-
- N-Hydroxymexiletine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
