CAS 55304-80-8

2,6-Dibromo-3-nitropyridine

Description:

2,6-Dibromo-3-nitropyridine is a heterocyclic organic compound characterized by its pyridine ring substituted with two bromine atoms at the 2 and 6 positions and a nitro group at the 3 position. This compound typically appears as a yellow to orange solid and is known for its aromatic properties, which contribute to its stability and reactivity. The presence of the nitro group introduces significant electron-withdrawing characteristics, influencing the compound's reactivity in electrophilic substitution reactions. Additionally, the bromine substituents can participate in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. 2,6-Dibromo-3-nitropyridine is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as a versatile building block. Its solubility in organic solvents and moderate stability under standard conditions make it a useful compound in laboratory settings. However, like many brominated and nitro compounds, it should be handled with care due to potential toxicity and environmental concerns.

Formula: C₅H₂Br₂N₂O₂

InChI: InChI=1S/C5H2Br2N2O2/c6-4-2-1-3(9(10)11)5(7)8-4/h1-2H

InChI key: InChIKey=FFRFTURYWWFKIC-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(Br)N=C(Br)C=C1

Synonyms:

• Pyridine, 2,6-dibromo-3-nitro-
• 2,6-Dibromo-3-nitropyridine

Pyridine, 2,6-dibromo-3-nitro-

CAS: 55304-80-8

Formula: C₅H₂Br₂N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 281.8896

Ref: IN-DA00I9VC

2,6-Dibromo-3-nitropyridine

CAS: 55304-80-8

2,6-Dibromo-3-nitropyridine

Formula: C₅H₂Br₂N₂O₂

Purity: ≥95%

Color and Shape: yellow crystalline powder

Molecular weight: 281.89g/mol

Ref: 54-OR13599

2,6-Dibromo-3-nitropyridine

CAS: 55304-80-8

Formula: C₅H₂Br₂N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 281.891

Ref: 10-F068386

2,6-Dibromo-3-nitropyridine

CAS: 55304-80-8

2,6-Dibromo-3-nitropyridine is a chemical compound that has been shown to inhibit serine protease activity. The compound was shown to be an inhibitor of the enzyme trypsin, and showed some activity against a number of other proteases. 2,6-Dibromo-3-nitropyridine has also been shown to inhibit nucleophilic alkylation of DNA bases by 2,6-dichloroquinoxaline. 2,6-Dibromo-3-nitropyridine is a targeted inhibitor that binds to the active site of the enzyme and prevents the formation of an enzyme-substrate complex. This inhibition leads to a decrease in the production of proteins essential for cell division.

Formula: C₅H₂Br₂N₂O₂

Purity: Min. 95%

Molecular weight: 281.89 g/mol

Ref: 3D-FD11914