CAS 55304-83-1

2,6-dibromopyridine-3-carbaldehyde

Description:

2,6-Dibromopyridine-3-carbaldehyde is an organic compound characterized by its pyridine ring substituted with two bromine atoms and an aldehyde functional group. The presence of bromine atoms at the 2 and 6 positions of the pyridine ring enhances its reactivity and influences its physical properties, such as solubility and boiling point. The aldehyde group at the 3-position contributes to its potential as a versatile building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. This compound typically appears as a pale yellow to brown solid or liquid, depending on its purity and specific conditions. It is soluble in organic solvents like ethanol and dichloromethane but may have limited solubility in water due to the hydrophobic nature of the brominated pyridine structure. Safety precautions should be taken when handling this compound, as brominated compounds can be hazardous. Overall, 2,6-dibromopyridine-3-carbaldehyde is valued for its unique chemical properties and applications in various chemical reactions.

Formula: C₆H₃Br₂NO

InChI: InChI=1/C6H3Br2NO/c7-5-2-1-4(3-10)6(8)9-5/h1-3H

SMILES: c1cc(Br)nc(c1C=O)Br

Synonyms:

• 2,6-Dibromonicotinaldehyde
• 2,6-Dibromopyridine-3-carboxaldehyde
• 3-Pyridinecarboxaldehyde, 2,6-Dibromo-

2,6-Dibromopyridine-3-carboxaldehyde

CAS: 55304-83-1

Formula: C₆H₃Br₂NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 264.9021

Ref: IN-DA00DG0C

2,6-Dibromonicotinaldehyde

CAS: 55304-83-1

2,6-Dibromonicotinaldehyde

Purity: 97%

Molecular weight: 264.90g/mol

Ref: 54-OR96717

2,6-Dibromonicotinaldehyde

CAS: 55304-83-1

Formula: C₆H₃Br₂NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 264.904

Ref: 10-F233386