CAS 55304-85-3

2,6-Dibromo-3-pyridinecarboxylic acid

Description:

2,6-Dibromo-3-pyridinecarboxylic acid is an organic compound characterized by its pyridine ring substituted with two bromine atoms and a carboxylic acid group. The presence of the bromine atoms at the 2 and 6 positions of the pyridine ring enhances its reactivity and can influence its biological activity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The carboxylic acid functional group contributes to its acidity and solubility in polar solvents, facilitating its use in chemical synthesis and as a potential ligand in coordination chemistry. This compound may exhibit antimicrobial or herbicidal properties due to its structural features. Additionally, its molecular structure allows for various synthetic modifications, making it a versatile intermediate in organic synthesis. Safety data should be consulted, as brominated compounds can pose environmental and health risks. Overall, 2,6-Dibromo-3-pyridinecarboxylic acid is a significant compound in the field of organic chemistry with potential applications in various industries.

Formula: C₆H₃Br₂NO₂

InChI: InChI=1/C6H3Br2NO2/c7-4-2-1-3(6(10)11)5(8)9-4/h1-2H,(H,10,11)

SMILES: c1cc(Br)nc(c1C(=O)O)Br

Synonyms:

• 2,6-Dibromonicotinic acid
• 2,6-Dibromopyridine-3-Carboxylic Acid

2,6-Dibromo-3-pyridinecarboxylic acid

CAS: 55304-85-3

Formula: C₆H₃Br₂NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 280.9015

Ref: IN-DA00D8EW

2,6-Dibromo-3-pyridinecarboxylic acid

CAS: 55304-85-3

2,6-Dibromo-3-pyridinecarboxylic acid

Purity: 98%

Molecular weight: 280.90g/mol

Ref: 54-OR73164

2,6-Dibromopyridine-3-carboxylic acid

CAS: 55304-85-3

Formula: C₆H₃Br₂NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 280.903

Ref: 10-F047661