CAS 55306-04-2

Sericoside

Description:

Sericoside, with the CAS number 55306-04-2, is a natural compound classified as a glycoside, specifically a type of flavonoid. It is primarily derived from various plant sources, particularly those in the genus *Euphorbia*. Sericoside is known for its potential pharmacological properties, including antioxidant, anti-inflammatory, and neuroprotective effects. The compound exhibits a complex structure that includes a sugar moiety attached to a flavonoid backbone, which contributes to its biological activity. In terms of solubility, sericoside is generally soluble in polar solvents, reflecting its glycosidic nature. Research has indicated that sericoside may play a role in various therapeutic applications, including the treatment of neurodegenerative diseases and as a protective agent against oxidative stress. However, further studies are necessary to fully elucidate its mechanisms of action and potential health benefits. Overall, sericoside represents a significant area of interest in phytochemistry and pharmacology due to its diverse biological activities.

Formula: C₃₆H₅₈O₁₁

InChI: InChI=1S/C36H58O11/c1-31(2)11-13-36(30(45)47-29-26(42)25(41)24(40)20(16-37)46-29)14-12-34(5)18(23(36)28(31)44)7-8-22-32(3)15-19(39)27(43)33(4,17-38)21(32)9-10-35(22,34)6/h7,19-29,37-44H,8-17H2,1-6H3/t19-,20-,21-,22-,23-,24-,25+,26-,27+,28+,29+,32+,33-,34-,35-,36+/m1/s1

InChI key: InChIKey=CMZFNIMQBCBHEX-JRIAKSEUSA-N

SMILES: C(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)(=O)[C@]23[C@](C=4[C@@](C)(CC2)[C@@]5(C)[C@](CC4)([C@]6(C)[C@@](CC5)([C@](CO)(C)[C@@H](O)[C@H](O)C6)[H])[H])([C@H](O)C(C)(C)CC3)[H]

Synonyms:

• Olean-12-en-28-oic acid, 2,3,19,23-tetrahydroxy-, β-D-glucopyranosyl ester, (2α,3β,4β,19α)-
• Sericoside

Sericoside

CAS: 55306-04-2

Sericoside

Purity: ≥98%

Molecular weight: 666.84g/mol

Ref: 54-BUP04780

Sericoside

CAS: 55306-04-2

Sericoside: a triterpenoid from Terminalia with strong anti-inflammatory and lipolytic effects, reducing wrinkles and enhancing skin texture.

Formula: C₃₆H₅₈O₁₁

Purity: 99.38%

Color and Shape: Solid

Molecular weight: 666.84

Ref: TM-T124663