
CAS 5532-23-0
:Jacozine
Description:
Jacozine, with the CAS number 5532-23-0, is a chemical compound that belongs to the class of alkaloids. It is primarily derived from certain plant sources, particularly those in the family of Apocynaceae. Jacozine is known for its complex molecular structure, which contributes to its biological activity. The compound exhibits various pharmacological properties, including potential anti-inflammatory and analgesic effects. Its mechanism of action may involve interactions with specific receptors or enzymes in biological systems. Additionally, Jacozine has been studied for its potential therapeutic applications, although further research is necessary to fully understand its efficacy and safety profile. As with many alkaloids, it is important to handle Jacozine with care due to its bioactive nature, which may lead to varying effects depending on dosage and individual response. Overall, Jacozine represents a fascinating area of study within natural product chemistry and pharmacology.
Formula:C18H23NO6
InChI:InChI=1S/C18H23NO6/c1-10-8-18(11(2)25-18)16(21)24-13-5-7-19-6-4-12(14(13)19)9-23-15(20)17(10,3)22/h4,11,13-14,22H,1,5-9H2,2-3H3/t11-,13+,14+,17+,18-/m0/s1
InChI key:InChIKey=XCEPKQNOWNOSFH-CGPXFRKCSA-N
SMILES:C[C@H]1[C@]2(O1)C(=O)O[C@]3([C@@]4(N(CC3)CC=C4COC(=O)[C@](C)(O)C(=C)C2)[H])[H]
Synonyms:- Senecionan-11,16-dione, 13,19-didehydro-15,20-epoxy-15,20-dihydro-12-hydroxy-, (15α,20S)-
- Spiro[[1,6]dioxacyclododecino[2,3,4-gh]pyrrolizine-3(2H),2′-oxirane]-2,7(4H)-dione, 5,6,9,11,13,14,14a,14b-octahydro-6-hydroxy-3′,6-dimethyl-5-methylene-, (2′S,3′S,6R,14aR,14bR)-
- Jacozine
- Spiro[[1,6]dioxacyclododecino[2,3,4-gh]pyrrolizine-3(2H),2′-oxirane]-2,7(4H)-dione, 5,6,9,11,13,14,14a,14b-octahydro-6-hydroxy-3′,6-dimethyl-5-methylene-, [3S-[3R*(R*),6S*,14aS*,14bS*]]-
- (2′S,3′S,6R,14aR,14bR)-5,6,9,11,13,14,14a,14b-Octahydro-6-hydroxy-3′,6-dimethyl-5-methylenespiro[[1,6]dioxacyclododecino[2,3,4-gh]pyrrolizine-3(2H),2′-oxirane]-2,7(4H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
