CAS 55332-38-2
:(αS)-4-Chloro-α-(1-methylethyl)benzeneacetic acid
Description:
(αS)-4-Chloro-α-(1-methylethyl)benzeneacetic acid, with the CAS number 55332-38-2, is a chiral compound characterized by its specific stereochemistry and functional groups. This substance features a benzene ring substituted with a chlorine atom and an isopropyl group, along with a carboxylic acid functional group. The presence of the chiral center at the alpha position relative to the carboxylic acid contributes to its optical activity, making it important in various applications, particularly in pharmaceuticals where stereochemistry can influence biological activity. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its chemical properties include potential reactivity typical of carboxylic acids, such as acid-base reactions and esterification. Additionally, the chlorine substituent can influence the compound's reactivity and interaction with biological systems. Overall, (αS)-4-Chloro-α-(1-methylethyl)benzeneacetic acid is significant in both synthetic chemistry and medicinal chemistry contexts.
Formula:C11H13ClO2
InChI:InChI=1S/C11H13ClO2/c1-7(2)10(11(13)14)8-3-5-9(12)6-4-8/h3-7,10H,1-2H3,(H,13,14)/t10-/m0/s1
InChI key:InChIKey=VTJMSIIXXKNIDJ-JTQLQIEISA-N
SMILES:[C@@H]([C@H](C)C)(C(O)=O)C1=CC=C(Cl)C=C1
Synonyms:- Benzeneacetic acid, 4-chloro-α-(1-methylethyl)-, (S)-
- (+)-α-(p-Chlorophenyl)isovaleric acid
- (αS)-4-Chloro-α-(1-methylethyl)benzeneacetic acid
- Benzeneacetic acid, 4-chloro-α-(1-methylethyl)-, (αS)-
- (S)-2-(4-Chlorophenyl)isovaleric acid
- Esfenvalerate free acid metabolite, 10 μg /μL in cyclohexane
- Benzeneacetic acid, 4-chloro-alpha-(1-methylethyl)-, (alphaS)-
- (S)-2-(4-Chlorophenyl)-3-methylbutanoicaci
- S-2-(4-chlorophenyl)-3-methylbutyricacid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzeneacetic acid, 4-chloro-a-(1-methylethyl)-, (aS)-
CAS:Formula:C11H13ClO2Purity:98%Color and Shape:SolidMolecular weight:212.6727(2S)-2-(4-Chlorophenyl)-3-methylbutanoic acid
CAS:(2S)-2-(4-Chlorophenyl)-3-methylbutanoic acidPurity:≥95%Molecular weight:212.67g/mol(S)-2-(4-Chlorophenyl)-3-methylbutanoic Acid
CAS:Controlled ProductApplications (S)-2-(4-CHLOROPHENYL)-3-METHYLBUTANOIC Acid (cas# 55332-38-2) is a useful research chemical.
Formula:C11H13ClO2Color and Shape:NeatMolecular weight:212.67(S)-2-(4-Chlorophenyl)-3-methylbutanoic acid
CAS:Formula:C11H13ClO2Purity:95%Color and Shape:SolidMolecular weight:212.67(S)-2-(4-Chlorophenyl)-3-methylbutanoic acid
CAS:(S)-2-(4-Chlorophenyl)-3-methylbutanoic acid is a chiral molecule that has been shown to be an inhibitor of isovaleric acid. It can be used as a marker for the amino acid sequence. It has been reported that (S)-2-(4-chlorophenyl)-3-methylbutanoic acid is an endogenous metabolite in humans and its concentration can be measured by enzyme-linked immunosorbent assay, high-performance liquid chromatography, and optical monitoring. This compound has also been studied as a potential therapeutic agent for the treatment of Alzheimer's disease due to its ability to inhibit acetylcholinesterase activity. It can also be conjugated with other molecules to form amide or ester conjugates.Formula:C11H13ClO2Purity:Min. 95%Molecular weight:212.67 g/mol




