CAS 55337-55-8
:2-(1,3-dioxolan-2-yl)-1-phenylethanone
Description:
2-(1,3-Dioxolan-2-yl)-1-phenylethanone, with the CAS number 55337-55-8, is an organic compound characterized by its unique structure that includes a phenyl group and a dioxolane ring. This compound typically exhibits properties associated with both ketones and cyclic ethers, which may influence its reactivity and stability. It is likely to be a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of the dioxolane moiety suggests potential applications in organic synthesis, particularly in the formation of more complex molecules through reactions such as nucleophilic attacks or ring-opening processes. Additionally, the phenyl group may impart aromatic characteristics, affecting the compound's solubility and interaction with other substances. As with many organic compounds, safety precautions should be taken when handling it, as it may pose risks such as irritation or toxicity. Overall, this compound's unique structure makes it of interest in various chemical applications, including pharmaceuticals and materials science.
Formula:C11H12O3
InChI:InChI=1/C11H12O3/c12-10(8-11-13-6-7-14-11)9-4-2-1-3-5-9/h1-5,11H,6-8H2
SMILES:c1ccc(cc1)C(=O)CC1OCCO1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.